Suchergebnisse für "NVR Network Camera"

1. High-speed multi-core processor ensures rapid response, stable transmission, and fast speed, suitable for WeChat chatting, video browsing, and gaming.2. Dual-system watch with call reminders: Connects to your phone via Bluetooth to synchronize SMS messages, call reminders, and view heart rate and blood oxygen levels on both your phone and watch.3. Heart rate, blood pressure, and blood oxygen levels are monitored using an upgraded bio-optical tracking sensor, enabling real-time monitoring to protect your health.4. Retractable 190-degree rotating camera: Can be hidden and can be used for free shooting from the front, back, and sides.5. Equipped with a 1990 mAh battery, its large capacity and high voltage ensure long battery life, achieving over 50 days of standby time and 10-15 days of daily use.6. Built-in 3D stereo navigation with GPS: Receives L1 and L5 satellite signals for dual-frequency GPS tracking, providing high positioning accuracy. Supports six satellite positioning systems, ensuring reliable coverage.7. 9. A 9-megapixel high-definition camera supports video calls, QR code payments, and capturing everyday moments with photos.8. It intelligently recognizes multiple sports modes, recording daily activity such as steps, distance, calories burned, and duration, generating a comprehensive report in the mobile application.9. Having passed IP67 testing, this smartwatch can accompany you through swimming, diving, surfing, and many other everyday water sports and activities.10. Face recognition technology achieves millisecond-level response speed; simply raise your wrist to unlock, protecting the watch's privacy and personal information security.11. NFC access keys connect various NFC commands to your watch, enabling access card emulation. The watch itself becomes the access card; simply raise your wrist to quickly unlock doors.Specification: Package Weight One Package Weight 0.24kgs / 0.54lb One Package Size 22cm * 13cm * 4cm / 8.66inch * 5.12inch * 1.57inch Qty per Carton 40 Carton Weight 11.50kgs / 25.35lb Carton Size 47cm * 26cm * 44cm / 18.5inch * 10.24inch * 17.32inch Loading Container 20GP: 495 cartons * 40 pcs = 19800 pcs40HQ: 1151 cartons * 40 pcs = 46040 pcs

Lesen Sie Mehr Weniger

Product parameters Display size: 4.3 inches Pixel: 1920 x 1080 Camera diameter: 8MM Battery capacity: 2000maH Charging time: 2.5H Use time: 3H Power input: DC 5V 500mA / 1A Length: 2 meters / 5 meters / 10 meters Image format :JPG Video format : AVI LED lights: 8 Focal length: 3-10cm Packing size: 165mm x 165mm x 65mmSpecification: General Certificate CE Package Weight One Package Weight 0.49kgs / 1.09lb One Package Size 16.5cm * 16.5cm * 6.5cm / 6.5inch * 6.5inch * 2.56inch Qty per Carton 34 Carton Weight 17.20kgs / 37.92lb Carton Size 47cm * 38cm * 39cm / 18.5inch * 14.96inch * 15.35inch Loading Container 20GP: 382 cartons * 34 pcs = 12988 pcs40HQ: 888 cartons * 34 pcs = 30192 pcs

Lesen Sie Mehr Weniger

Specifications: 1. CPU Chip: Mediatek Dimensity 6360 Max Octa Core, 2.4GHz 2. GPU: ARM Mali-G57 MC2 1072MHz 3. RAM + ROM: 8GB+256GB; RAM: LPDDR4X; ROM: UFS 2.2 4. Extended Storage: Support 5. SIM Card Type: Nano-SIM card/Nano-USIM card 7. Biometrics Recognition: Fingerprint (Screen), facial recognition 8. Sensor: Proximity sensor, ambient light sensor, electronic compass, accelerometer, gyroscope, under-display optical fingerprint sensor, infrared remote control 9. Operating System: ColorOS 16.0 10. Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 11. Dimensions: 159.08 x 75.81 x 8.80 mm 12. Weight: Approx. 205g Screen Display: 1. Size: 6.57 inches 2. Resolution: FHD+ 2372 x 1080 pixels 3. Colors: 1.07 billion colors 4. Brightness: 800-1400 nits 5. Type: AMOLED, 92.8% screen-to-body ratio, 397 PPI, 120Hz refresh rate Cameras: 1. Rear: 50MP wide-angle camera, f/1.9 aperture, 25mm equivalent focal length, 5P lens, supports autofocus (AF) 2. Front: 8MP camera, f/2.1 aperture, 25mm equivalent focal length, 4P lens Battery: 1. Battery capacity: 8000mAh 2. Fast charging: 45W Network Band: 1. 5G: NR n1/n3/n5/n8/n28A/n38/n40/n41/n48/n77/n78 2. 4G: FDD-LTE: B1/3/5/8/28A; TDD-LTE: B34/38/39/40/41/42/48 3. 3G: WCDMA B1/5/8 4. 2G: GSM 900/1800MHz Data Function: 1. WLAN: Supports Wi-Fi 5 (802.11ac), 802.11a/b/g/n, Wi-Fi Display, and WLAN network sharing 2. Bluetooth: V5.4; supports SBC, AAC, LDAC, aptX, and aptX HD 3. Data & Headphone Interface: USB Type-C 4. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS, A-GNSS assisted positioning, wireless LAN positioning, cellular network positioning 5. NFC: Yes 6. OTG: Yes Packing List: 1. Phone x 1 2. Charger x 1 3. Data cable x 1 4. SIM Ejector tool x 1 5. Protective case x 1 6. Quick Start Guide x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs

Lesen Sie Mehr Weniger

1. CPU: SC9832+NRF28222. RAM: 2GB/4GB3. ROM: 16GB/128G4. Camera (front/side): 5MP / 8MP5. Battery: 850mAh6. Network: 4G-LTE TDDLTE+FDDLTE7. System: Android 9.18. Positioning: GPS+GLONASS9. Sensor: blood oxygen sensor10. Bluetooth: V5.011. Case material: ceramic12. Dial material: glass13. Strap Material: Silicone14. Screen: 1.75 inches 320x385 resolution15. Charging time: 1.5 hours16. Use time: 24 hours17. Standby time: 7-10 days18. Waterproof: IP67 life waterproof19. SIM card: Nano SIM card20. Network band:- FDD LTE: B1(2100)B2(1900)B3(1800)B5(850)B7(2600)B8(900)B12(700)B17(700)B20(800)- WCDMA: B1(2100)B5(850)B2(1900)- GSM: B2(1900)B3(1800) B5(850) B8(900)21. Audio format: MP3, WMA, Flac22. Video format: MP4 RMVB, RM23. Image format: JPG, PNG, Gif24. Data transmission method: Pogo pin25. Languages: Simplified Chinese, English, Italian, French, German, Spanish, Portuguese, Russian, Japanese, Thai, Arabic, Korean, Greek, Korean, Dutch, Tagalog, Danish26. Other functions: voice recorder, calendar, voice search, face recognition, video chat, pedometer, heart rate, information, map, music sync function, weather, alarm, Google APP27. Dimensions: 50.4x41mm28. Thickness: 16.1mm29. Strap width: 22mm30. Watch net weight: 90g31. Packing List- Watch x 1- User Manual x 1- 5 Pin Magnetic Data Cable x 1- Screwdriver x 1Specification: Package Weight One Package Weight 0.32kgs / 0.69lb One Package Size 12cm * 11cm * 7.5cm / 4.72inch * 4.33inch * 2.95inch Qty per Carton 30 Carton Weight 9.00kgs / 19.84lb Carton Size 53cm * 24cm * 25cm / 20.87inch * 9.45inch * 9.84inch Loading Container 20GP: 838 cartons * 30 pcs = 25140 pcs40HQ: 1946 cartons * 30 pcs = 58380 pcs

Lesen Sie Mehr Weniger

1. Chip: MTK6737 quad-core CPU 2. Running memory (RAM): 2GB 3. Body memory (ROM): 16GB 4. Features: Large buttons, one-touch flashlight on the side, BT, WiFi, FM, MP3, MP4, it has Wi-Fi and hotspot capabilities, and supports downloads (however, not all apps compatible with Android 8.1 can be downloaded due to system limitations). 5. System: Android 8.1 (system cannot be upgraded) 6. Screen: 2.8-inch LCD screen 7. Support memory card: Support, expandable up to 32GB (not included) 8. Front camera: 2MP 9. Rear camera: 2MP 10. Battery capacity: 2200mAh 11. Size: 141 x 60 x 14.3mm 12. Network Band: 2G GSM 850/900/1800/1900MHz3G WCDMA B1/B5/B84G FDD: B1/B3/B5 TDD B40/B41 Note: 4G only for Europe and Asia (not compatible in South America) Packing List: 1. Mobile phone x 1 2. USB-C cable x 1 3. Eject Pin x 1 4. Protective film x 1 5. Manual x 1 (Subject to the actual product)Specification: Package Weight One Package Weight 0.19kgs / 0.43lb One Package Size 15cm * 8cm * 4cm / 5.91inch * 3.15inch * 1.57inch Qty per Carton 50 Carton Weight 9.50kgs / 20.94lb Carton Size 36cm * 35cm * 18cm / 14.17inch * 13.78inch * 7.09inch Loading Container 20GP: 1175 cartons * 50 pcs = 58750 pcs40HQ: 2729 cartons * 50 pcs = 136450 pcs

Lesen Sie Mehr Weniger

SpecificationsSpecification: 1. Processor: Qualcomm Snapdragon 8 Elite Gen 5 mobile platform SoC 3nm octa-core processor, up to 4.6GHz 2. GPU: Adreno 3. Memory capacity: 12GB+512GB / LPDDR5X + UFS 4.1 4. Operating system: Xiaomi HyperOS 3 5. Fingerprint unlocking: 3D ultrasonic fingerprint 6. Sensors: Proximity sensor, under-screen ambient light (color temperature) sensor, rear-mounted ambient light (color temperature) sensor, accelerometer, gyroscope, electronic compass, X-axis linear motor, infrared remote control, flicker sensor, laser focus sensor, barometer, Hall effect sensor 7. Dimensions: 151.1 x 71.8 x 8.0mm 8. Weight: 192g 9. Charging port: Type-C 10. SIM card slot: Dual Nano-SIM card slot 11. Language: English, Simplified Chinese, Traditional Chinese Screen Display: Main: 1. Screen: 6.3 inch 1.5K AMOLED 2. Pixels: 2656 x 1220 3. Refresh rate: 120Hz 4. Sampling rate: 300Hz 5. Glass cover: Xiaomi Longjing Glass Rear: 1. Screen: 2.7 inch AMOLED 2. Pixels: 904 x 572 3. Refresh rate: 120Hz 4. Sampling rate: 120Hz 5. Glass cover: Xiaomi Longjing Glass Battery: 1. Battery capacity: 6300mAh 2. Charging power: 100W wired, 50W wireless 3. Fast charging: QC3+ / QC3.0 / QC2.0 / PD3.0 / PD2.0 Cameras: 1. Rear: 50MP main (Light Hunter 950L, 23mm, f1.67, OIS) + 50MP dynamic periscope telephoto (20cm telephoto focal length, f3.0, OIS) + 50MP wide (f2.4) 2. Front: 50MP (f2.2) Network frequency band: 1. 5G: N1/2/3/5/7/8/12/18/20/25/26/28/38/40/41/48/66/77/78/80/81/83/84/89 2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/17/18/19/20/25/26/28/66; TDD-LTE: B34/38/39/40/41/42/48 3. 3G: WCDMA: B1/2/4/5/6/8/19 4. 2G: GSM: B2/3/5/8 Wireless network: 1. WiFi: Supports Wi-Fi 7, Wi-Fi 6 Advanced, Wi-Fi 5, Wi-Fi 4, and 802.11a/b/g, 2.4G & 5G 2. BT: V5.4 3. Navigation: Beidou, GPS, Galileo, GLONASS, QZSS,NaVIC, AGNSS, Data Network Positioning,Wi-Fi Network Positioning, Sensor-Assisted Positioning 4. Support multi-function NFCPackage List1. Mobile Phone x 1 2. Eject Tool x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Power Adapter x 1 6. Pre-attached Protective Film x 1 (The actual product shall prevail)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs

Lesen Sie Mehr Weniger

1. CPU: SC9832E+PAR28222. Supported systems: Android 8.0 and above, IOS 11.0 and above3. Touch screen: 2.02-inch TFT display4. Resolution: 400x454 pixels5. Memory: RAM: 4GB, ROM: 128GB6. SIM card: independent standby, hands-free calling, Nano SIM7. Network: 2G/3G/4G8. Camera:Front camera: 2 million high-definition cameraSide camera: 8 million high-definition camera9. Frequency range:GSM: 850900/nB30/1900WCDMA: B1/B2/B5LTE-FDD: B1/283/B5/B7/B8/B12/B17/B20LTE-TDD: B38/B39/B40/B41(100M)10. Bluetooth/WiFi: supported11. GPS: support12. Bluetooth: 5.013. WIFI: 2.4GHz14. Heart rate sensor: VC32S15. Data interface: magnetic cable16. Battery capacity: 750mAh17. Waterproof level: IP6818. Supported languages: Simplified Chinese, Traditional Chinese, English, Italian (Switzerland), French, German, Spanish, Portuguese, Russian, Japanese, Arabic (Israel), Korean (Korean), Dutch (Belgium) , Danish, Croatian, Czech, Indonesian, Malay, Polish, Turkish, Catalan (Spain), Slovak, Burmese (official), Cambodian, Estonian, Nepali19. Dimensions: watch head: 55 x 48 x 17mm, strap 24mm, buckle 20mm, overall circumference 258mm20. Product net weight: 120 gramsPacking list:-Smart watch x 1-Magnetic cord x 1-Screwdriver x 1-Manual x 1Specification: Package Weight One Package Weight 0.26kgs / 0.58lb One Package Size 11cm * 11cm * 8cm / 4.33inch * 4.33inch * 3.15inch Qty per Carton 50 Carton Weight 14.00kgs / 30.86lb Carton Size 55cm * 23cm * 42cm / 21.65inch * 9.06inch * 16.54inch Loading Container 20GP: 501 cartons * 50 pcs = 25050 pcs40HQ: 1165 cartons * 50 pcs = 58250 pcs

Lesen Sie Mehr Weniger

1. CPU: SP9832E2. System: Android 8.13. Display: 1.54-inch TFT4. Touch screen: full-circle full-touch5. Resolution: 360 x 3606. RAM/ROM: RAM: 4GB + ROM: 64GB7. SIM card: Nano SIM8. Network: 2G/3G/4G9. System: Android 8.110. Frequency band: GSM: 850 / 900 / 1800 / 1900, WCDMA: B1/B2/B5/B8, LTE-FDD: B1/B2/B3/B5/B7/B8/B20, LTE-TDD: B38/39/40/41 (100MHz)11. Camera: 2 million front camera; 5 million side camera12. Bluetooth version: 4.213. Bluetooth effective distance: 10 meters (open environment)14. Heart rate sensor: 8009315. G-sensor (accelerometer): 3D G-Sensor16. Wifi: 2.4G17. GPS: with low noise amplifier, supports: Beidou, GPS18. Battery: 800mAh19. Battery life: 2 days20. Charging method: magnetic charging21. Charging time: 3 hours22. Product functions: support manual selection of language on the watch, AI voice assistant, making and receiving calls, phone book, sending text messages, WIFI, Bluetooth, downloading third-party APPs, video calls, taking pictures, alarm clock, calendar, calculator, recording, local music playback, weather, step counting, heart rate, multi-sports mode, pressure gauge; find mobile phone, stopwatch, music control, raise your hand to light up the screen, change the dial, etc.23. Sports functions: outdoor running, outdoor walking, indoor running, badminton, basketball, table tennis, football, skipping rope, cycling24. Full-time display: date, day of the week, clock, minute (real-time display); time format: 12/24-hour dual format;25. Walking exercise monitoring: accurate monitoring of walking (number of steps), physical energy consumption (calories), walking distance (km); 24-hour full-time monitoring.26. Watch hardware language: Chinese (Simplified), Chinese (Traditional), Arabic (Israel), Dutch (Belgium), English (US), French, German, Italian (Switzerland), Portuguese, Spanish, Croatian, Czech, Danish, Indonesian, Japanese, Korean (Korean), Malay, Polish, Russian, Turkish, Catalan (Spain), Slovak, Burmese (official), Cambodian, Estonian, Nepali, Hebrew27. APP support system: Android 6.0 and above, iOS11.0 and above28. Watch head size: 51 x 51 x 15.4mm29. Watch strap size: 22mm30. Product weight: 85gPacking list:-Smart watch x 1-Magnetic charging cable x 1-Instruction manual x 1Specification: Package Weight One Package Weight 0.26kgs / 0.57lb One Package Size 11cm * 11cm * 8cm / 4.33inch * 4.33inch * 3.15inch Qty per Carton 50 Carton Weight 11.00kgs / 24.25lb Carton Size 57cm * 24cm * 44cm / 22.44inch * 9.45inch * 17.32inch Loading Container 20GP: 443 cartons * 50 pcs = 22150 pcs40HQ: 1028 cartons * 50 pcs = 51400 pcs

Lesen Sie Mehr Weniger

Product parameters Display size: 4.3 inches Pixel: 1920 x 1080 Camera diameter: 8MM Battery capacity: 2000maH Charging time: 2.5H Use time: 3H Power input: DC 5V 500mA / 1A Length: 2 meters / 5 meters / 10 meters Image format :JPG Video format : AVI LED lights: 8 Focal length: 3-10cm Packing size: 165mm x 165mm x 50mmSpecification: General Certificate CE Package Weight One Package Weight 0.35kgs / 0.77lb One Package Size 16.5cm * 14.5cm * 6cm / 6.5inch * 5.71inch * 2.36inch Qty per Carton 40 Carton Weight 14.30kgs / 31.53lb Carton Size 47cm * 38cm * 39cm / 18.5inch * 14.96inch * 15.35inch Loading Container 20GP: 382 cartons * 40 pcs = 15280 pcs40HQ: 888 cartons * 40 pcs = 35520 pcs

Lesen Sie Mehr Weniger

1. Auflösung: 1MP 2. CMOS: OV9734 3. Sichtfeld: 70 Grad 4. LED-Leuchten: 1 + 6 Stück, dimmbar 5. Wasserdichtigkeit: IP67 6. Bildqualität: 720x1280, 480x720 7. Videoqualität: 720P@30fps, 480P@30fps 8. Videoformat: MP4 9. Schnittstelle: uSmart-Erweiterungsanschluss 10. Kabellänge: 2m 11. Kamerataste: kurz drücken zum Umschalten der Kamera, lange drücken für Bilder. 12. LED-Helligkeit: Radsteuerung 13. Packliste: 1 x digitales Mikroskop Ständer x 1 Benutzerhandbuch x 1 Schraubendreher x 1 Schrauben x 2 Mikrometer-Kalibrierungslineal x 1 Spezifikation: Paketgewicht Gewicht eines Pakets 0,18 kg / 0,39 lb Einheitspackungsgröße 20 cm * 10 cm * 3,5 cm / 7,87 Zoll * 3,94 Zoll * 1,38 Zoll Menge pro Karton 80 Kartongewicht 12,56 kg / 27,69 lb Kartongröße 40 cm * 42 cm * 35 cm / 15,75 Zoll * 16,54 Zoll * 13,78 Zoll Container laden 20GP: 453 Kartons * 80 Stück = 36240 Stück 40HQ: 1052 Kartons * 80 Stück = 84160 Stück

Lesen Sie Mehr Weniger

1. Equipped with the Impinj E710 chip, it boasts a peak read rate exceeding 700 tags per second and a long read distance. 2. Built-in high-gain 9dBi antenna provides wide coverage, sensitive card reading, and stable performance. 3. Multiple communication interfaces and a separate cable design for ease of use. 4. Flexible operating mode selection: Active, Passive, and Trigger. 5. Integrated structure with IP67-rated waterproof, dustproof, and lightning protection, making it easily adaptable to diverse outdoor environments. 6. Wide range of applications: Suitable for warehousing and logistics, production line tracking, intelligent asset management, and access control systems. Product Specifications: 1. Model: FI-807 2. Dimensions: 305mm x 305mm x 75mm 3. Operating Frequency: Standard: ISM 902-928MHz and ISM 865-868MHz, optional. 4. Operating Protocols: ISO18000-6C (EPC GEN2), ISO18000-6B 5. Reading distance: 0-18m 6. Output power: 0-33dBm, software-adjustable 7. Operating mode: Wide-spectrum frequency hopping (FHSS) 8. Antenna gain: Built-in circularly polarized antenna, 9dBi gain 9. Communication interfaces: RS232, RS485, RJ45, Wiegand 26/34, one trigger output, one relay output (optional WiFi, 4G, and other communication options, PoE power supply) 10. Operating indicator: Buzzer 11. Power supply: DC+12V (with power adapter), voltage range: 9-16V 12. Operating temperature: -20 degrees Celsius to +80 degrees CelsiusSpecification: Package Weight One Package Weight 3.06kgs / 6.75lb One Package Size 56cm * 56cm * 12cm / 22.05inch * 22.05inch * 4.72inch Qty per Carton 5 Carton Weight 16.00kgs / 35.27lb Carton Size 58cm * 58cm * 36cm / 22.83inch * 22.83inch * 14.17inch Loading Container 20GP: 220 cartons * 5 pcs = 1100 pcs40HQ: 511 cartons * 5 pcs = 2555 pcs

Lesen Sie Mehr Weniger

Product parameters: 1. Lens diameter: 8.0MM 2. Resolution 1280*720 3. Sensor size: 1/5 inch 4. Frame rate: 30fps 5. Angle of view: 70 degrees 6. Focal length: 4-10CM. 7. Waterproof rating: IP67 8. Exposure lamp automatic 9. Working temperature 0 degrees to 70 degrees 10. 8.0MM Len 6pcs adjustable LED light waterproof; 11. Power supply: built-in battery 12. Battery capacity: 800 mAh 13. Support computer: ios android windows 14. Photo format: MJPEG 15. Video format: MP4 16. Scope of application: pipeline maintenance, vehicle maintenance, maritime exploration, anti terror bomb removal, satellite maintenance and repair, fire rescue search, air conditioning maintenance and testing, large-scale precision instrument monitoring Specification: General Certificate CE Package Weight One Package Weight 0.35kgs / 0.78lb One Package Size 15cm * 15cm * 5cm / 5.91inch * 5.91inch * 1.97inch Qty per Carton 60 Carton Weight 21.90kgs / 48.28lb Carton Size 50cm * 40cm * 35cm / 19.69inch * 15.75inch * 13.78inch Loading Container 20GP: 380 cartons * 60 pcs = 22800 pcs40HQ: 884 cartons * 60 pcs = 53040 pcs

Lesen Sie Mehr Weniger