Suchergebnisse für "Case Micro USB Cable"

1. CPU model: Dimensity 6300, octa-core, 2xA76 2.4GHz + 6xA55 2.0GHz 2. GPU: G57 MC2 3. Operating System: MagicOS 9.0 (based on Android 15) 4. User Interface: MagicOS 9.0 5. Storage RAM+ROM: 12GB+256GB 6. SIM Card: Nano card, Dual SIM dual standby 7. Data Charging Interface: Type-C 8. Earphones Interface: 3.5mm 9. Sensors: Accelerometer, proximity sensor, fingerprint sensor (side), compass, gravity sensor 10. Languages: Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian 11. Dimensions: 163.95 x75.6 x 8.39mm 12. Weight: 197g (including battery) Screen: 1. Screen Size: 6.61 inch 2. Screen Color Gamut: 16.7 million colors 3. Screen Ratio: 20.05:9 4. Screen Type: TFTLCD 5. Screen Resolution: 720 x 1604 6. Touch Screen: Multi-touch, up to 10 touch points 7. Refresh Rate: 120Hz 8. Screen Ratio: 90.5% Cameras: 1. Rear Camera: 13MP (f1.8) 2. Front Camera: 5MP (f2.0) 3. Front Camera Functions: Normal photo, portrait mode, time-lapse photography, smile capture, selfie mirror, photo filter, watermark mode, etc. 4. Rear Camera Functions: Time-lapse photography, night scene mode, portrait mode, video recording, professional photo, panoramic photo, dual-view video recording, HDR photo, smile capture, micro-movie mode, timed photo, etc. Battery: 1. Battery Type: Lithium-ion polymer battery 2. Battery Capacity: 6000mAh 3. Charge: 5V3A Network: 1. Network frequency: A. 5G: SA B. 4G: TDD-LTE, FDD-LTE C. 3G: WCDMA D. 2G: GSM 2. WLAN: 802.11 a/b/g/n/ac, 2.4GHz and 5GHz 3. BT: BT5.3 4. OTG: Support 5. GPS: Support, Glonass, Beidou, Galileo Package List 1. Phone x 1 2. Eject Pin x 1 3. TPU protective case x 1 4. Type-C USB cable x 1 5. US Plug charger x 1 6. TP protective film (pre-attached) x 1 (Note: subject to the actual product)Specification: Package Weight One Package Weight 0.50kgs / 1.11lb One Package Size 22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch Loading Container 20GP: 578 cartons * 20 pcs = 11560 pcs40HQ: 1343 cartons * 20 pcs = 26860 pcs

Lesen Sie Mehr Weniger

1. CPU model: Snapdragon 7 Gen 3, octa-core, 1 x Cortex-A715 2.63GHz + 3 x Cortex-A715 2.4GHz + 4 x Cortex-A510 1.8GHz 2. GPU: Adreno 720 3. Operating System: MagicOS 9.0 (based on Android 15) 4. User Interface: MagicOS 9.0 5. Storage RAM+ROM: 8GB+256GB 6. SIM Card: Nano card, Dual SIM dual standby 7. Data Charging / Earphones Interface: Type-C 8. Sensors: Accelerometer, proximity light sensor, fingerprint sensor (in-screen), compass, gyroscope, gravity sensor, NFC 9. Languages: Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian 10. Dimensions: 163.7 x 76.7 x 7.98mm 11. Weight: 209g (including battery) Screen: 1. Screen Size: 6.78 inch 2. Screen Color Gamut: 107 million colors, DCI-P3 3. Screen Ratio: 19.85:9 4. Screen Type: AMOLED equal depth micro four-curved screen 5. Screen Resolution:2700 x 1224 6. Touch Screen: Multi-touch, up to 10 touch points 7. Screen Refresh Rate: 60/90/120Hz 8. Screen Ratio: 93.30% Cameras: 1. Rear Camera: 50MP wide (f1.95) + 5MP 2. Front Camera: 16MP (f2.45) Battery: 1. Battery Type: Lithium-ion polymer battery 2. Battery Capacity: 8000mAh 3. Charger: 20V 4A 4. Theoretical Charging Time: About 68 minutes Network: 1. Network Frequency: A. 5G: NR B. 4G: TDD-LTE, FDD-LTE C. 3G: WCDMA D. 2G: GSM 2. WLAN: 802.11 a/b/g/n/ac/ax, 2.4GHz and 5GHz 3. BT: BT5.3 4. OTG: Support 5. GPS: Support, Glonass, Beidou, AGPS, Galileo 6. NFC: Support Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective case x 1 4. Type-C USB cable x 1 5. US Plug charger x 1 6. Protective film (pre-attached) x 1 (Note: subject to the actual product)Specification: Package Weight One Package Weight 0.50kgs / 1.11lb One Package Size 22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch Loading Container 20GP: 578 cartons * 20 pcs = 11560 pcs40HQ: 1343 cartons * 20 pcs = 26860 pcs

Lesen Sie Mehr Weniger

Ring-LED 1. Das LED-Ringlicht kann an der Halterung befestigt und überallhin mitgenommen werden. Es kann auch jederzeit vom Ständer abgenommen werden. Der Kugelkopf des Stativs ist um 360 Grad drehbar und kann frei auf jeden Winkel eingestellt werden (die Halterung ist nicht im Lieferumfang enthalten). 2. Das Ringlicht besteht aus 40 energiesparenden LED-Perlen, hat eine ausgezeichnete Wärmeableitung, Konstantstromantrieb und hohe Farbwiedergabe, macht die Lichtquelle weicher und verbessert den Hautton bei der Porträtfotografie. 4. 3-Farben-Beleuchtungsmodus mit einstellbarer Helligkeit zur Auswahl. Sie können Farbe und Helligkeit ganz einfach anpassen. Eine gute Helligkeit kann ohne Installation zusätzlicher Farbfilter erreicht werden. Drei Farben sanften natürlichen Lichts erhellen Ihre Schönheit bei verschiedenen Gelegenheiten. 5. Die USB-Anschlüsse können mit mehreren Geräten verwendet werden, z. B. zum Anschließen eines Computer-Hosts, eines Laptops, einer mobilen Stromversorgung und eines USB-Ladegeräts. Sie können das LED-Ringlicht jederzeit kostenlos nutzen. 6. Leichtes und tragbares Design: Bequem zu verwenden und zu tragen, wenn Sie reisen oder im Freien arbeiten usw. 7. Wärmeableitungsfunktion: Metallgehäuse, auch bei längerem Gebrauch besteht kein Grund zur Sorge, dass die Lampe heiß wird. 8. Umfangreiche Anwendung: Es wird häufig für Fotolicht im Freien, Fülllicht im Innenbereich, Porträt-, Mode- und Werbefotografie, Videoaufnahmen usw. verwendet. Vlogging-Ausrüstung 1. Es ist ein Muss für Sie, wenn Sie gerne qualitativ hochwertige Videos aufnehmen. Es erleichtert das Aufnehmen von Videos erheblich, da Sie mit zwei Griffen einen viel besseren Halt haben. 2. Mit 3 Standard-Schuhmontageschlitzen können Sie Beleuchtung und Mikrofon anbringen. Ein gutes Werkzeug für alle, die qualitativ hochwertige Telefone oder Videos in nahezu professionellem Niveau aufnehmen müssen. 3. Das spezielle Design ermöglicht es Ihnen, stabile Aufnahmen zu machen und einzigartige Lebenserlebnisse festzuhalten 4. Ein unverzichtbares Zubehör für alle, die ihre Filmfähigkeiten mit einem Telefon verbessern möchten, das bessere Bilder macht als viele High-End-Kameras. Sie können es mit jedem Stativ, Slider oder Dolly montieren. 5. Kompatibel mit den meisten Smartphones des iPhone/Samsung/Huawei/OPPO/vivo/Xiaomi mit oder ohne Hülle mit einer Breite von 1,7 bis 4,3 Zoll. Ring-LED-Spezifikationen 1. Anzahl der Perlen: 40 Stück 2. Lampenperlenmodell: 2835 3. Lampenhelligkeit: 24-26lm 4. Weißlicht-Farbtemperatur: 6500K 5. Warmweiße Farbtemperatur: 3200K 6. Leistung: 4-8W 7. Spannung: 5V 8. Zeigt an: Ra>82 9. Dimmbereich: 1%-100% 10. Schalenmaterial: Aluminium 11. Maße: Außendurchmesser 120 mm, Innendurchmesser 86 mm 12. Stromversorgung: Stromversorgung über USB-Anschluss Paketliste 1. Ring-LED-Licht x 1 2. Videoausrüstung x 1 3. Kaltschuh-Stativkopf x 1 4. 3,5-mm-Audio-Adapterkabel x 2 5. Farbpaketbox x 1 Spezifikation: Paket enthalten Packungsinhalt Videoausrüstung x 1 1 x LED-Ringlicht USB-Kabel-Steuerung x 1 Kaltschuh-Stativkopf x 1 Farbpaketbox x 1 Paketgewicht Gewicht eines Pakets 0,44 kg / 0,98 lb Einheitspackungsgröße 27 cm * 16 cm * 7 cm / 10,63 Zoll * 6,3 Zoll * 2,76 Zoll Menge pro Karton 30 Kartongewicht 11,50 kg / 25,35 lb Kartongröße 54 cm * 42 cm * 38 cm / 21,26 Zoll * 16,54 Zoll * 14,96 Zoll Container laden 20GP: 309 Kartons * 30 Stück = 9270 Stück 40HQ: 718 Kartons * 30 Stück = 21540 Stück

Lesen Sie Mehr Weniger

1. CPU model: Snapdragon 7 Gen 3, octa-core, 1 x Cortex-A715 2.63GHz + 3 x Cortex-A715 2.4GHz + 4 x Cortex-A510 1.8GHz 2. GPU: Adreno 720 3. Operating System: MagicOS 9.0 (based on Android 15) 4. User Interface: MagicOS 9.0 5. Storage RAM+ROM: 12GB+256GB 6. SIM Card: Nano card, Dual SIM dual standby 7. Data Charging / Earphones Interface: Type-C 8. Sensors: Accelerometer, proximity light sensor, fingerprint sensor (in-screen), compass, gyroscope, gravity sensor, NFC 9. Languages: Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian 10. Dimensions: 163.7 x 76.7 x 7.98mm 11. Weight: 209g (including battery) Screen: 1. Screen Size: 6.78 inch 2. Screen Color Gamut: 107 million colors, DCI-P3 3. Screen Ratio: 19.85:9 4. Screen Type: AMOLED equal depth micro four-curved screen 5. Screen Resolution:2700 x 1224 6. Touch Screen: Multi-touch, up to 10 touch points 7. Screen Refresh Rate: 60/90/120Hz 8. Screen Ratio: 93.30% Cameras: 1. Rear Camera: 50MP wide (f1.95) + 5MP 2. Front Camera: 16MP (f2.45) Battery: 1. Battery Type: Lithium-ion polymer battery 2. Battery Capacity: 8000mAh 3. Charger: 20V 4A 4. Theoretical Charging Time: About 68 minutes Network: 1. Network Frequency: A. 5G: NR B. 4G: TDD-LTE, FDD-LTE C. 3G: WCDMA D. 2G: GSM 2. WLAN: 802.11 a/b/g/n/ac/ax, 2.4GHz and 5GHz 3. BT: BT5.3 4. OTG: Support 5. GPS: Support, Glonass, Beidou, AGPS, Galileo 6. NFC: Support Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective case x 1 4. Type-C USB cable x 1 5. US Plug charger x 1 6. Protective film (pre-attached) x 1 (Note: subject to the actual product)Specification: Package Weight One Package Weight 0.50kgs / 1.11lb One Package Size 22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch Loading Container 20GP: 578 cartons * 20 pcs = 11560 pcs40HQ: 1343 cartons * 20 pcs = 26860 pcs

Lesen Sie Mehr Weniger

1. CPU: MediaTek Dimensity 6100+ Octa Core 2.2GHz2. Memory Capacity: 4GB+128GB / 6GB+128GB / 8GB+256GB optional3. RAM+ROM: LPDDR4X + UFS 2.2 4. Operating System: MIUI 145. Sensors: Ambient light sensor, acceleration sensor, virtual gyroscope, electronic compass, infrared remote control, virtual distance sensor6. SIM Card Slots: Nano-SIM + Nano-SIM or Nano-SIM + micro-SD7. Charging Interface: Type-C8. Headphone Jack: 3.5mm9. Dimensions: 168.05 x 77.91 x 8.19mm10. Weight: 195gScreen Display:1. Screen size: 6.74 inch2. Screen type/material: LCD3. Screen ratio: 20.6:94. Resolution: 2460 x 1080px5. Screen refresh rate: 90Hz6. Touch sampling rate: 180Hz7. Contrast: 1500:18. Features: Double Rheinland eye protection certificationBattery:1. Battery capacity: 5000mAh2. Charging power: 18W wired chargingCameras:1. Rear camera: 50MP ultra-clear main camera + 2MP depth camera2. Front camera: 5MP3. Photo functions: Rear camera photo functions: Super night scene, HDR, 10x digital zoom, portrait mode, movie mode, timed continuous shooting, 50MP mode, film camera; Front camera photo functions: Timed continuous shooting, AI beauty, portrait mode, movie mode, HDR, countdown, screen fill light, gesture selfie4. Video shooting : 1080P 30fps, 720P 30fps video recording, time-lapse photographyNetwork Band:1. 4G: FDD-LTE: B1/B3/B5/B8; TDD-LTE: B34/B38/B39/B40/B413. 3G WCDMA: B1/B5/B84. 2G GSM: B3/B5/B8Wireless Network:1. WiFi: 2.4GHz & 5GHz2. Bluetooth: V5.33. Navigation positioning: GPS, Beidou, Galileo, GLONASS4. Support multi-function NFCMedia:1. Audio: MP3, FLAC, APE, M4A, AAC, OGG, WAV, AMR, AWB2. Video : MP4, M4V, 3GP, 3G2, MKV, WEBMLanguage: English, Simple Chinese, Traditional ChinesePacking List:1. Mobile phone x 12. Eject Pin x 13. Protective case x 14. USB cable x 15. US charging head x 16. Pre-attached protective film x 1(The actual product shall prevail)Specification: Package Weight One Package Weight 0.50kgs / 1.11lb One Package Size 22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch Loading Container 20GP: 578 cartons * 20 pcs = 11560 pcs40HQ: 1343 cartons * 20 pcs = 26860 pcs

Lesen Sie Mehr Weniger

SpecificationsPlatform: 1. Operating system: Android 14, OriginOS 4, Jovi: supports Jovi scanning, Blue Heart V and other functions 2. Chipset: 3rd generation Snapdragon 7 mobile platform 3. CPU: 64-bit octa-core, 2.63GHzx1+2.4GHzx3+1.8GHzx4, process technology: 4nm 4. GPU: Adreno 720 5. Memory: 12GB+256GB Screen: 1. Type: AMOLED, 144Hz 2. Size: 6.78 inches (screen-to-body ratio 93.42%) 3. Resolution: 2800 x 1260 pixels, 20:9 ratio 4. Screen color: 1.07 billion colors 5. Screen PPI: 452PPI 6. Contrast: 8000000:1 7. Color saturation: 105% NTSC Body: 1. Size: 163.72mmx75.88mmx7.98mm 2. Weight: about 194.6g 3. Middle frame material: plastic 4. SIM: dual card (Nano-SIM, dual standby) Camera: 1. Rear camera: dual camera, 50MP (f1.79 rear main camera) + 2MP (f2.4 blur) 2. Rear camera modes: sports, night scene, portrait, photo, video, micro movie, high pixel (50 million), panorama, ultra-clear document, slow motion, time-lapse photography, super moon, professional, professional video, dynamic photo 3. Front camera: 16MP (f2.45) 4. Front camera modes: portrait, photo, video, micro movie, dynamic photo 5. Zoom mode: front camera supports 2x digital zoom, rear main camera supports 10x digital zoom 6. Focus type: front camera supports FF focus, rear camera supports AF focus, rear camera supports FF focus 7. Video recording: front camera supports 1080P, rear camera supports 4K Features: 1. Sensors: gravity sensor, light sensor, proximity sensor, gyroscope, electronic compass, infrared remote control, linear motor 2. Languages: Arabic, Bengali, Burmese, Dutch, English, French, Filipino, German, Hindi, Indonesian, Italian, Japanese, Khmer, Malay, Portuguese, Russian, Romanian, Spanish, Thai, Vietnamese, Nepali, Urdu, Sinhalese, Laotian, Korean, Tibetan, Uyghur Battery: 1. Type: 6000mAh, non-removable 2. Charging: 80W, Charging specification 11V/7.3A, compatible with 11V/5A, 11V/4A, 11V/3A, 10V/2.25A, 9V/1.4A or 5V/2ANetwork & ConnectionNetwork: 1. 5G: n1/n5/n8/n28A/n38/n41/n77/n78 2. 4G FDD-LTE: B1/B3/B5/B8/B28A 3. 4G TD-LTE: B34/B38/B39/B40/B41 4. 3G WCDMA: B1/B5/B8 5. 2G GSM: 850/900/1800MHz 6. 2G CDMA: BC0 Connection and transmission: 1. WLAN: WLAN 2.4G, WLAN 5.1G, WLAN 5.8G, Wi-Fi Display, 2x2 MIMO, MU-MIMO, WiFi6 2. Navigation: Support GPS: L1, Beidou: B1C, B1I, GLONASS: G1, Galileo: E1, QZSS: L1 3. BT transmission: BT 5.4 (BT audio specifications SBC, AAC, aptX, aptX HD, aptX Adaptive, aptX Lossless, LDAC) 4. Headphone interface standard & USB interface type: Type-C 5. OTG data transmission: supported 6. NFC: supportedPackage List1. Mobile phone x 1 2. US charger x 1 3. Type-C cable x 1 4. Protective case x 1 5. Protective film (already affixed at the factory) x 1 6. Card pin x 1 7. Quick start guide x 1 (Note: subject to the actual product) Specification: Package Weight One Package Weight 0.73kgs / 1.61lb One Package Size 21cm * 21cm * 7cm / 8.27inch * 8.27inch * 2.76inch Qty per Carton 20 Carton Weight 15.00kgs / 33.07lb Carton Size 42cm * 45cm * 35cm / 16.54inch * 17.72inch * 13.78inch Loading Container 20GP: 403 cartons * 20 pcs = 8060 pcs40HQ: 935 cartons * 20 pcs = 18700 pcs

Lesen Sie Mehr Weniger

1. Chip: MT6580A Quad-Core-CPU 2. Arbeitsspeicher (RAM): 1 GB 3. Körperspeicher (ROM): 16 GB 4. Funktionen: Gesichtserkennung, Entsperren durch gefälschte Fingerabdrücke auf dem Bildschirm, mit WIFI+BT+FM+GPS, Micro-USB-Schnittstelle 5. System: Android 8.1 6. Bildschirmgröße: 6,1-Zoll-Kapselbildschirm-Erscheinungsbild, 480 x 1010 Pixel Auflösung 7. Unterstützte Speicherkarte: Unterstützt, erweiterbar auf bis zu 128 GB (nicht im Lieferumfang enthalten, unterstützt die gleichzeitige Installation von zwei SIM-Karten und einer TF-Karte). 8. Frontkamera: 2 Millionen Pixel, f/2.0-Blende, Fixfokus 9. Rückkamera: 5 Millionen Pixel (Farbe, f/1.8 Blende) Autofokus 10. Batteriekapazität: 2800 mAh 11. Netzwerkformat: 3G WCDMA: 850/2100 MHz 2G GSM: 850/900/1800/1900 MHz Dual-SIM-Karte, Dual-Standby, Nano-SIM-Karte 3-Auswahl von 3 SIM-Karten, unterstützt 2 Mobiltelefonkarten + 1 Speicherkarte gleichzeitig 12. Schale: Galvanisierter Rahmen, AG-Glas-Milchschale Packliste: 1. Mobiltelefon x 1 2. Ladegerät x 1 3. USB-Kabel x 1 4. Kopfhörer x 1 5. Handy-Schutzfolie x 1 6. Schutzhülle x 1 7. Auswurfstift x 1 8. Bedienungsanleitung x 1 9. Verpackungsbox x 1 Aufmerksamkeit 1. Aufgrund unterschiedlicher Lichtverhältnisse kann die tatsächliche Farbe des Telefons leicht von der auf dem Bildschirm und dem Bild abweichen. Farbnamen dienen nur zur Unterscheidung zwischen einzelnen SKUs. Bitte haben Sie dafür Verständnis. Vielen Dank. 2. Die Akkukapazität ist typisch für das Werkslabor, die spezifische Ladegeschwindigkeit, die Nutzungsdauer und andere Daten. Die tatsächliche Situation wird aufgrund des Netzkabels, des Netzteils und der Umgebungstemperatur leicht abweichen. Wenn das Telefon vollständig entladen ist und automatisch herunterfährt, müssen Sie Ihr Telefon zum Starten länger als 10 Minuten aufladen. Es wird empfohlen, das Telefon aufzuladen, wenn der Akku weniger als 20 % geladen ist. 3. Die verfügbare Speicherkapazität hängt von der vorinstallierten Software ab 4. Produktbilder und -modelle, Daten, Funktionen, Leistung, Spezifikationen usw. dienen nur als Referenz. Wir können die oben genannten Inhalte verbessern. Einzelheiten entnehmen Sie bitte dem Produkt und der Produktbeschreibung. Sofern nicht anders angegeben, sind die auf dieser Website enthaltenen Daten unsere internen Testergebnisse und die Vergleiche werden mit unseren Produkten verglichen. 5. Das Mobiltelefon unterstützt nicht das Telekommunikations-CDMA Spezifikation: Paketgewicht Gewicht eines Pakets 0,40 kg / 0,88 lb Einheitspackungsgröße 19 cm * 10 cm * 5 cm / 7,48 Zoll * 3,94 Zoll * 1,97 Zoll Menge pro Karton 20 Kartongewicht 9,00 kg / 19,84 lb Kartongröße 42 cm * 25 cm * 20 cm / 16,54 Zoll * 9,84 Zoll * 7,87 Zoll Container laden 20GP: 1269 Kartons * 20 Stück = 25380 Stück 40HQ: 2947 Kartons * 20 Stück = 58940 Stück

Lesen Sie Mehr Weniger

1. CPU model: Dimensity 6300, octa-core, 2xA76 2.4GHz + 6xA55 2.0GHz 2. GPU: G57 MC2 3. Operating System: MagicOS 9.0 (based on Android 15) 4. User Interface: MagicOS 9.0 5. Storage RAM+ROM: 6GB+128GB 6. SIM Card: Nano card, Dual SIM dual standby 7. Data Charging Interface: Type-C 8. Earphones Interface: 3.5mm 9. Sensors: Accelerometer, proximity sensor, fingerprint sensor (side), compass, gravity sensor 10. Languages: Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian 11. Dimensions: 163.95 x75.6 x 8.39mm 12. Weight: 197g (including battery) Screen: 1. Screen Size: 6.61 inch 2. Screen Color Gamut: 16.7 million colors 3. Screen Ratio: 20.05:9 4. Screen Type: TFTLCD 5. Screen Resolution: 720 x 1604 6. Touch Screen: Multi-touch, up to 10 touch points 7. Refresh Rate: 120Hz 8. Screen Ratio: 90.5% Cameras: 1. Rear Camera: 13MP (f1.8) 2. Front Camera: 5MP (f2.0) 3. Front Camera Functions: Normal photo, portrait mode, time-lapse photography, smile capture, selfie mirror, photo filter, watermark mode, etc. 4. Rear Camera Functions: Time-lapse photography, night scene mode, portrait mode, video recording, professional photo, panoramic photo, dual-view video recording, HDR photo, smile capture, micro-movie mode, timed photo, etc. Battery: 1. Battery Type: Lithium-ion polymer battery 2. Battery Capacity: 6000mAh 3. Charge: 5V3A Network: 1. Network frequency: A. 5G: SA B. 4G: TDD-LTE, FDD-LTE C. 3G: WCDMA D. 2G: GSM 2. WLAN: 802.11 a/b/g/n/ac, 2.4GHz and 5GHz 3. BT: BT5.3 4. OTG: Support 5. GPS: Support, Glonass, Beidou, Galileo Package List 1. Phone x 1 2. Eject Pin x 1 3. TPU protective case x 1 4. Type-C USB cable x 1 5. US Plug charger x 1 6. TP protective film (pre-attached) x 1 (Note: subject to the actual product)Specification: Package Weight One Package Weight 0.50kgs / 1.11lb One Package Size 22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch Loading Container 20GP: 578 cartons * 20 pcs = 11560 pcs40HQ: 1343 cartons * 20 pcs = 26860 pcs

Lesen Sie Mehr Weniger

FeaturesThe WAVEGO is a high-DOF bionic dog-like robot which features 2.3kg.cm large torque servos, reliable structure, and flexible motion, incorporating devices like front camera, 9-axes motion tracker, RGB indicator, etc., together with open source multi-platform Web application. It uses the ESP32 as sub controller for connecting rod inverse solving and gait generation, sharing calculating task for the host controller, an additional Raspberry Pi can be attached as the host controller for high-level decision operating. 1. Overall 12-DOF, multi connecting rods leg design, increasing the servo effective torque 2. A real time operating system is used as sub controller for connecting rod inverse solving and gait generation, sharing calculating task for the host controller and improving the gait solving efficiency 3. Ultra compact structure design, allows using on the table, aluminum alloy + nylon structure materials, ensuring strength while keeping it light weight 4. Additional Raspberry Pi can beattached as the host controller to enable OpenCV high-level functions, demo codes including facial recognition, motion detection, color tracking, and more. Reserved extension interface for secondary development, along with user manual and secondary development documents.SpecificationsGeneral: 1. Product name: WAVEGO high-DOF bionic quadruped robot 2. Stand up: length 218mm, width 116mm, height 152mm 3. Lie down: length 228mm, width 116mm, height 127mm 4. Overall weight: 465g (with batteries) 5. DOF: 12 overall, 3 per single leg Operating system: Demo code: FreeRTOS + Raspberry Pi OS Motion performance: 1. Available gait: Shake hands, stand up, crouch slowly, diagonal gait , jump, self-balancing 2. Motion extension: Providing motion programming example, including flexible Bezier curve speed motion function 3. Load: 300g Servo info.: 1. Dimensions: 23.2 x12.1 x25.25 mm 2. Weight: 13.0 +/- 1g 3. Operating voltage: 6V 4. Idle speed: 0.1sec/60 degree (100RPM) 5. Stalling torque: 2.3kg.cm (31.99oz.in) 6. Rated load: 0.7kg.cm 7. Rated current: 350mA 8. Control method: Pulse width modification 9. Control system type: Digital comparator Visual function: 1. FreeRTOS demo: Web-based real time video streaming 2. Raspberry Pi OS demo: Real time video streaming, facial recognition, color tracking, moving object detection Note: All the demo codes are open sourced, the Raspberry Pi OS demo is based on open source projects flask-streaming and OpenCV Processor and memory: 1. ESP32 sub controller: Processor: Xtensa LX6 dual-core processor 240MHz 2. SRAM: 520KB+8MB 3. Flash: 448KB+4MB Others: 1. WiFi standard: 802.11b/g/n 2. Bluetooth standard: Bluetooth 4.2, including traditional Bluetooth (BR/EDR) and Bluetooth low energy (BLE) 3. External port: 2 x 5P multi-function extension port (host controller communication, power supply selection, assembly mode selection, etc.) 4. DC battery charger jack: Type-C (download, UART communication, peripheral expansion) Power supply: 1. Battery type: 18650 Li-ion batteries (NOT included) 2. Supply voltage: 7-8.4V 3. Recharge voltage: 8.4V 4. Protection: Over charge, discharge protection, over current protection, short circuit protection, reverse proof, equalizing charge, stable and safe operating 5. Output voltage: provides 5V output for other host controllerPackage List1. WAVEGO body case x 1 2. WAVEGO basic parts x 1 3. Semi-transparent acrylic panel x 1 4. Double-sided sticker x 1 5. WAVEGO base board x 1 6. 2MP camera x 1 7. 2.4G antenna x 1 8. 0.91 inch OLED display x 1 9. Micro thrust bearing x 14 10. Micro ball flange bearing x30 11. USB cable (~1m) x 1 12. Plus screwdriver x 1 13. Cross wrench sleeve x 1 14. IPEX 1 to SMA cable (~17cm) x 1 15. Jumper wire (~20cm) x4 16. 4PIN PH2.0 cable x 1 17. Servo pack x 1 18. 8.4V 2A battery charger x 1 19. Screws and standoffs x 1Specification: Package Weight One Package Weight 1.06kgs / 2.34lb One Package Size 26cm * 22cm * 10cm / 10.24inch * 8.66inch * 3.94inch Qty per Carton 20 Carton Weight 16.00kgs / 35.27lb Carton Size 52cm * 53cm * 45cm / 20.47inch * 20.87inch * 17.72inch Loading Container 20GP: 215 cartons * 20 pcs = 4300 pcs40HQ: 499 cartons * 20 pcs = 9980 pcs

Lesen Sie Mehr Weniger

SpecificationsPlatform: 1. Operating system: Android 14, OriginOS 4 2. Jovi: supports voice, suggestions, scanning and other functions 3. Chipset: Second-generation Snapdragon 8 mobile platform 4. CPU: 64-bit octa-core, 3.2GHzx1+2.8GHzx4+2.0GHzx3, process technology: 4nm 5. GPU: Adreno 740 6. Memory: 12GB+256GB / 16GB+256GB / 16GB+512GB / 16GB+1TB (optional); RAM: LPDDR5X four-channel, ROM: UFS 4.0 7. Sensors: gravity sensor, light sensor, proximity sensor, gyroscope, electronic compass, infrared remote control; flicker sensor; color temperature sensor; linear motor 8. Battery: 5160mAh non-removable lithium battery 9. Charging: 120W ultra-fast flash charging, supports 20V/6A (Max), compatible with 20V/4A, 20V/3.3A, 11V/6A, 11V/5A, 11V/4A, 11V/3A, 9V/2A or 5V/3A 10. OTG reverse charging: supported Screen: 1. Screen size: 6.78 inches 2. Screen material: AMOLED 3. Screen ratio: 20:9 4. Screen ratio: 93.43% 5. Resolution: 2800 x 1260 6. Screen refresh rate: up to 144Hz 7. Screen sampling rate: 130Hz for normal scenes, 300Hz for some game scenes 8. Screen type: flat screen 9. Unlocking method: Face Wake facial recognition, screen fingerprint Body: 1. Dimensions: 163.53mm x 75.68mm x 7.99mm (black, blue, white); 163.53mm x 75.68mm x 8.34mm (red) 2. Weight: about 196g (black, blue, white); about 190g (red) 3. Material: plastic frame, glass or leather back cover 4. SIM: dual card (Nano-SIM, dual standby) Camera: 1. Sensor: CMOS 2. Front camera pixel: 16 million pixels 3. Front camera aperture: f/2.45 4. Rear camera pixel: 50 million pixel ultra-clear main camera + 8 million pixel wide-angle lens 5. Rear camera aperture: f/1.88 (rear main camera), f/2.2 (rear wide-angle) 6. Zoom mode: rear supports 20x digital zoom 7. Camera modes: Front camera: portrait, photo, video, micro-movie Rear camera: snapshot, night scene, portrait, photo, video, micro-movie, 50MP, panorama, ultra-clear document, slow motion, time-lapse photography, time slow door, super moon, professional, Jovi scanNetwork & ConnectionNetwork: 1. 5G: n1/n3/n5/n8/n28A/n38/n40/n41(160MHz)/n77/n78 2. 4G TD-LTE: B34/B38/B39/B40/B41(160MHz) 3. 4G FDD-LTE: B1/B3/B4/B5/B7/B8/B18/B19/B26/B28A 4. 3G WCDMA: B1/B4/B5/B6/B8/B19 5. 2G GSM: 850/900/1800MHz 6. 2G CDMA: BC0 Connection and Transmission: 1. Wi-Fi: Support WLAN 2.4G, WLAN 5.1G, WLAN 5.8G frequencies; support Wi-Fi 6, Wi-Fi 7 2. Navigation: Support GPS: L1, Beidou: B1C+B1I, GLONASS: G1, Galileo: E1, QZSS: L1, support AGPS, cellular network positioning, wireless LAN positioning 3. Bluetooth transmission: BT5.3, support Bluetooth audio specifications: SBC; AAC; aptX; aptX HD; aptX Adaptive; aptX Lossless; LDAC 4. Headphone jack standard: Type-C 5. USB interface type: Type-C 6. OTG data transmission: support 7. NFC: Supported Languages: Arabic, Bengali, Burmese, Dutch, English, French, Filipino, German, Hindi, Indonesian, Italian, Japanese, Khmer, Malay, Portuguese, Russian, Romanian, Spanish, Thai, Vietnamese, Nepali, Urdu, Sinhalese, Laotian, Korean, Tibetan, UyghurPackage List1. Mobile phone x 1 2. US charger x 1 3. Type-C cable x 1 4. Protective case x 1 5. Protective film (pre-installed) x 1 6. Card ejector x 1 7. Quick start guide x 1 8. Mobile phone box x 1 (Note: subject to the actual product)Specification: Package Weight One Package Weight 0.70kgs / 1.55lb One Package Size 21cm * 21cm * 7cm / 8.27inch * 8.27inch * 2.76inch Qty per Carton 20 Carton Weight 15.00kgs / 33.07lb Carton Size 42cm * 45cm * 35cm / 16.54inch * 17.72inch * 13.78inch Loading Container 20GP: 403 cartons * 20 pcs = 8060 pcs40HQ: 935 cartons * 20 pcs = 18700 pcs

Lesen Sie Mehr Weniger

1. CPU model: Dimensity 6300, octa-core, 2xA76 2.4GHz + 6xA55 2.0GHz 2. GPU: G57 MC2 3. Operating System: MagicOS 9.0 (based on Android 15) 4. User Interface: MagicOS 9.0 5. Storage RAM+ROM: 8GB+256GB 6. SIM Card: Nano card, Dual SIM dual standby 7. Data Charging Interface: Type-C 8. Earphones Interface: 3.5mm 9. Sensors: Accelerometer, proximity sensor, fingerprint sensor (side), compass, gravity sensor 10. Languages: Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian 11. Dimensions: 163.95 x75.6 x 8.39mm 12. Weight: 197g (including battery) Screen: 1. Screen Size: 6.61 inch 2. Screen Color Gamut: 16.7 million colors 3. Screen Ratio: 20.05:9 4. Screen Type: TFTLCD 5. Screen Resolution: 720 x 1604 6. Touch Screen: Multi-touch, up to 10 touch points 7. Refresh Rate: 120Hz 8. Screen Ratio: 90.5% Cameras: 1. Rear Camera: 13MP (f1.8) 2. Front Camera: 5MP (f2.0) 3. Front Camera Functions: Normal photo, portrait mode, time-lapse photography, smile capture, selfie mirror, photo filter, watermark mode, etc. 4. Rear Camera Functions: Time-lapse photography, night scene mode, portrait mode, video recording, professional photo, panoramic photo, dual-view video recording, HDR photo, smile capture, micro-movie mode, timed photo, etc. Battery: 1. Battery Type: Lithium-ion polymer battery 2. Battery Capacity: 6000mAh 3. Charge: 5V3A Network: 1. Network frequency: A. 5G: SA B. 4G: TDD-LTE, FDD-LTE C. 3G: WCDMA D. 2G: GSM 2. WLAN: 802.11 a/b/g/n/ac, 2.4GHz and 5GHz 3. BT: BT5.3 4. OTG: Support 5. GPS: Support, Glonass, Beidou, Galileo Package List 1. Phone x 1 2. Eject Pin x 1 3. TPU protective case x 1 4. Type-C USB cable x 1 5. US Plug charger x 1 6. TP protective film (pre-attached) x 1 (Note: subject to the actual product)Specification: Package Weight One Package Weight 0.50kgs / 1.11lb One Package Size 22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch Loading Container 20GP: 578 cartons * 20 pcs = 11560 pcs40HQ: 1343 cartons * 20 pcs = 26860 pcs

Lesen Sie Mehr Weniger

1. CPU model: Dimensity 6300, octa-core, 2xA76 2.4GHz + 6xA55 2.0GHz 2. GPU: G57 MC2 3. Operating System: MagicOS 9.0 (based on Android 15) 4. User Interface: MagicOS 9.0 5. Storage RAM+ROM: 8GB+256GB 6. SIM Card: Nano card, Dual SIM dual standby 7. Data Charging Interface: Type-C 8. Earphones Interface: 3.5mm 9. Sensors: Accelerometer, proximity sensor, fingerprint sensor (side), compass, gravity sensor 10. Languages: Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian 11. Dimensions: 163.95 x75.6 x 8.39mm 12. Weight: 197g (including battery) Screen: 1. Screen Size: 6.61 inch 2. Screen Color Gamut: 16.7 million colors 3. Screen Ratio: 20.05:9 4. Screen Type: TFTLCD 5. Screen Resolution: 720 x 1604 6. Touch Screen: Multi-touch, up to 10 touch points 7. Refresh Rate: 120Hz 8. Screen Ratio: 90.5% Cameras: 1. Rear Camera: 13MP (f1.8) 2. Front Camera: 5MP (f2.0) 3. Front Camera Functions: Normal photo, portrait mode, time-lapse photography, smile capture, selfie mirror, photo filter, watermark mode, etc. 4. Rear Camera Functions: Time-lapse photography, night scene mode, portrait mode, video recording, professional photo, panoramic photo, dual-view video recording, HDR photo, smile capture, micro-movie mode, timed photo, etc. Battery: 1. Battery Type: Lithium-ion polymer battery 2. Battery Capacity: 6000mAh 3. Charge: 5V3A Network: 1. Network frequency: A. 5G: SA B. 4G: TDD-LTE, FDD-LTE C. 3G: WCDMA D. 2G: GSM 2. WLAN: 802.11 a/b/g/n/ac, 2.4GHz and 5GHz 3. BT: BT5.3 4. OTG: Support 5. GPS: Support, Glonass, Beidou, Galileo Package List 1. Phone x 1 2. Eject Pin x 1 3. TPU protective case x 1 4. Type-C USB cable x 1 5. US Plug charger x 1 6. TP protective film (pre-attached) x 1 (Note: subject to the actual product)Specification: Package Weight One Package Weight 0.50kgs / 1.11lb One Package Size 22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch Loading Container 20GP: 578 cartons * 20 pcs = 11560 pcs40HQ: 1343 cartons * 20 pcs = 26860 pcs

Lesen Sie Mehr Weniger