Resultados de la búsqueda de "charger usb c charging cable"
-
OPPO OPPO Find X9 Ultra Satellite AI Phone, 16GB+1TB, Screen Fingerprint, 6.82 inch ColorOS 16.0 Snapdragon 8 Elite Gen 5 Octa Core, NFC, OTG, Network: 5G, 16GB+1TB
Specification: 1. CPU: Snapdragon 8 Elite Gen 5, octa-core, 4.608 GHz 2. GPU: Adreno 840 1200MHz 3. RAM+ROM: 16GB+1TB 4. RAM: LPDDR5X, ROM: UFS 4.1 5. Expanded storage: Not supported 6. Operating system: ColorOS 16.0 7. SIM card type: Nano-SIM card, Nano-USIM card, dual stand-by 8. Biometrics: Fingerprint (under screen), facial recognition 9. Sensors: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, in-display ultrasonic fingerprint sensor, Hall effect sensor, pressure sensor, laser autofocus sensor, spectral sensor, infrared remote control 10. Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Korean, Tibetan, Uyghur 11. Size: 163.16 x 76.97 x 8.65-9.10mm 12. Weight: 235-236g Screen Display: 1. Size: 6.82 inch 2. Resolution: 3168 x 1440, 94.6%, AMOLED, 510PPI 3. Colors: 1.07 billion colors 4. Touch sampling rate: Up to 300Hz, default 120Hz 5. Refresh rate: 1-120Hz, Max 144Hz (144Hz only works in some game scenarios) Camera: 1. Rear: 200MP Wide (f1.5) + 50MP Ultra-Wide (f2.0) + 200MP Telephoto (f2.2) + 50MP Super Telephoto (f3.5, 230mm) + Gen 2 Danxia Color Reproduction Lens (f2.4) 2. Front: 50MP (f2.4) Battery: 1. Battery capacity: 7050mAh 2. Power: 100W wired charge, 50W wireless charge Network Band: 1. 5G NR: N1/2/3/5/7/8/12/18/20/25/26/28/38/40/41/48/66/77/78/79/80/81/83/84/89 2. 4G: LTE TDD: B34/38/39/40/41/42/43/48; LTE FDD: B1/2/3/4/5/7/8/12/17/18/19/20/25/26/28/66 3. 3G: WCDMA B1/2/4/5/6/8/19 4. 2G: GSM 850/900/1800MHz 5. Support VoLTE Data Functions: 1. WLAN: Wi-Fi 7 (802.11be),Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n 2. BT: V6.0 3. Data charging and headphone interface: USB Type-C 4. OTG: Support 5. NFC: Support 6. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS Package List 1. Phone x 1 2. Data cable x 1 3. Charger x 1 4. SIM Eject Pin x 1 5. Protective Case x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs
£1,706.99
-
vivo vivo X200 Ultra, 12GB+256GB, Face ID / 3D Ultrasonic Fingerprint, 6.82 inch OriginOS 5 / Android 15 Snapdragon 8 Elite Octa Core, OTG, NFC, Network: 5G, Support Google Play, 12GB+256GB
Specifications: 1. CPU: Qualcomm Snapdragon 8 Elite, octa-core, 4.32GHz x 2+3.53GHz x 6 2. GPU: Adreno 830 3. RAM: 12GB LPDDR5X Ultra, ROM: 256GB UFS 4.1 4. Operation System: OriginOS 5 based on Android 15 5. Sensors: Gravity sensor, light sensor, proximity sensor, physical gyroscope, electronic compass, front color temperature sensor, rear color temperature sensor, laser focus sensor, infrared remote control, flicker sensor, multi-spectral sensor, X-axis linear motor 6. Battery: 6000mAh 7. Fast charging: 90W wired, 40W wireless flash charging 8. SIM card: Dual, Nano-SIM card 9. Charging & Headphone Interface: Type-C 10. Language: Arabic, Bengali, Burmese, Dutch, English, French, Filipino, German, Hindi, Indonesian, Italian, Japanese, Khmer, Malay, Portuguese, Russian, Romanian, Spanish, Thai, Vietnamese, Nepali, Urdu, Sinhalese, Laotian, Kor., Tibetan, Uyghur 11. Unlock Method: Face Wake ID, 3D Ultrasonic single point fingerprint 12. Dimensions: 163.09 x 76.80 x 8.78mm 13. Weight: About 226g Display Screen: 1. Size: 6.82 inch, 19.8:9 2. Type: Flat screen, 510 PPI, 93.3% 3. Resolution: 3168 x 1440 4. Color: 1.07 billion colors 5. Refresh Rate: 1-120Hz Cameras: 1. Rear camera: 50MP main (f1.69) + 50MP wide (f2.0) + 200MP periscope (2.27) 2. Front Camera: 50MP (f2.45) Network Frequency Band: 1. 5G NR: N1/N2/N3/N5/N7/N8/N12/N18/N20/N25/N26/N28/N38/N40/N41/N48/N66/N77/N78/N79/N80/N81/N83/N84/N89 2. 4G LTE FDD: B1/B2/B3/B4/B5/B7/B8/B12/B17/B18/B19/B20/B25/B26/B28/B66; LTE TDD: B34/B38/B39/B40/B41/B42/B43/B48 3. WCDMA: B1/B2/B4/B5/B8/B6/B19 4. GSM: 850/900/1800/1900MHz 5. WLAN: 2.4G&5GHz, support Wi-Fi 6, Wi-Fi 7 7. BT: V5.4 8. NFC: Yes 9. OTG: Yes 10. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS, GNSS Package List: 1. Phone x 1 2. Eject Pin x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Charger x 1 6. Protective Film (Pre-applied) x 1 (The actual object shall prevail)Specification: Package Weight One Package Weight 0.70kgs / 1.55lb One Package Size 21cm * 21cm * 7cm / 8.27inch * 8.27inch * 2.76inch Qty per Carton 20 Carton Weight 15.00kgs / 33.07lb Carton Size 42cm * 45cm * 35cm / 16.54inch * 17.72inch * 13.78inch Loading Container 20GP: 403 cartons * 20 pcs = 8060 pcs40HQ: 935 cartons * 20 pcs = 18700 pcs
£1,109.99
-
OPPO OPPO Reno15, 12GB+256GB, Screen Fingerprint, 6.32 inch ColorOS 16.0 MediaTek Dimensity 8450 Octa Core, NFC, OTG, Network: 5G, 12GB+256GB
Specifications: 1. CPU: Dimensity 8450, octa-core, 3.35GHz 2. GPU: ARM G720 MC7 1300MHz 3. RAM + ROM: 12GB LPDDR5X + 256GB UFS3.1 4. Extended storage: Not support 5. Operating System: ColorOS 16.0 6. SIM card type: Nano-SIM card, support dual SIM cards 7. Biometrics Recognition: Fingerprint (in-screen), facial recognition 8. Sensor: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, in-display optical fingerprint sensor, infrared remote control. 9. Support Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 10. Dimensions: 151.21 x 72.42 x 7.99-8.13mm 11. Weight: 187-188g Screen Display: 1. Size: 6.32 inch 2. Resolution: 2640 x 1216 pixels, 460 PPI 3. Color: 1070 million colors 4. Brightness: 600 nits, 1800 nits 5. Type: AMOLED, 120Hz refresh rate, 240Hz touch sample rate 6. Screen-to-body Ratio: 93.4% Cameras: 1. Rear: Rear: 200MP wide (f1.8, 24mm, 6P lens, AF, OIS) + 50MP ultra-wide (f2.0, 16mm, 6P lens, AF, 116 degree) + 50MP telephoto (f2.8, 80mm, 4P lens, AF, OIS) 2. Front: 50MP (F2.0, 18mm, 5P lens, AF) Battery: 1. Battery Capacity: 6200mAh 2. Fast Charge: 80W Network Band: 1. 5G: NR N1/3/5/8/18/26/28A/34/38/39/40/41/48/66/77/78 2. 4G: FDD-LTE: B1/3/4/5/8/18/19/26/28A/66; TDD-LTE: B34/38/39/40/41/42/43/48 3. 3G: WCDMA B1/4/5/8/19 4. 2G: GSM 850/900/1800MHz Data Function: 1. WLAN: Support Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n, Wi-Fi 5GHz 160MHz 2. BT: V5.4 3. Data Charge & Headphone Interface: USB Type-C 4. OTG: Support 5. NFC: Support 6. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS Package List 1. Phone x 1 2. Data Cable x 1 3. US Plug Charger x 1 4. Eject Pin x 1 5. Protective Case x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs
£531.99
-
OPPO OPPO Reno16 Pro, 12GB+512GB, Screen Fingerprint, 6.78 inch ColorOS 16.0 MediaTek Dimensity 9500s Octa Core, NFC, OTG, Network: 5G, 12GB+512GB
Specifications: 1. CPU: MediaTek Dimensity 9500s, octa-core, 3.73GHz 2. GPU: Immortalis G925 MC12 1612MHz 3. RAM + ROM: 12GB LPDDR5X + 512GB UFS3.1 4. Extended storage: Not support 5. Operating System: ColorOS 16.0 6. SIM card type: Nano-SIM card, Nano-USIM card, support dual SIM cards 7. Biometrics Recognition: Fingerprint (in-screen), facial recognition 8. Sensor: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, in-display optical fingerprint sensor, Hall effect sensor, infrared remote control 9. Support Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 10. Dimensions: 161.26 x 76.46 x 7.65-7.86mm 11. Weight: 205-208g Screen Display: 1. Size: 6.78 inch 2. Resolution: 2772 x 1272 pixels, 450 PPI 3. Color: 1070 million colors 4. Brightness: 600 nits, 1800 nits 5. Type: AMOLED, 120Hz refresh rate, 240Hz touch sample rate 6. Screen-to-body Ratio: 95.5% Cameras: 1. Rear: Rear: 200MP wide (f1.8, 24mm, 6P lens, AF, OIS) + 50MP ultra-wide (f2.0, 16mm, 6P lens, AF, 116 degree) + 50MP telephoto (f2.8, 80mm, 4P lens, AF, OIS) 2. Front: 50MP (F2.0, 18mm, 5P lens, AF) Battery: 1. Battery Capacity: 7000mAh 2. Fast Charge: 80W wired, 50W wireless Network Band: 1. 5G: NR N1/2/3/5/8/18/26/28A/34/38/39/40/41/48/66/77/78/79 2. 4G: FDD-LTE: B1/2/3/4/5/8/18/19/25/26/28A/66; TDD-LTE: B34/38/39/40/41/42/43/48 3. 3G: WCDMA B1/4/5/8/19 4. 2G: GSM 850/900/1800MHz Data Function: 1. WLAN: Support Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n, Wi-Fi 5GHz 160MHz 2. BT: V5.4 3. Data Charge & Headphone Interface: USB Type-C 4. OTG: Support 5. NFC: Support 6. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS, NavIC Package List 1. Phone x 1 2. Data Cable x 1 3. US Plug Charger x 1 4. Eject Pin x 1 5. Protective Case x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs
£808.99
-
OPPO OPPO Reno16, 16GB+256GB, Screen Fingerprint, 6.32 inch ColorOS 16.0 MediaTek Dimensity 8550 SUPER Octa Core, NFC, OTG, Network: 5G, 16GB+256GB
Specifications: 1. CPU: Dimensity 8550 SUPER, octa-core, 3.4GHz 2. GPU: ARM G720 MC8 1500MHz 3. RAM + ROM: 16GB LPDDR5X/LPDDR5 + 256GB UFS3.1 4. Extended storage: Not support 5. Operating System: ColorOS 16.0 6. SIM card type: Nano-SIM card, support dual SIM cards 7. Biometrics Recognition: Fingerprint (in-screen), facial recognition 8. Sensor: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, in-display optical fingerprint sensor, infrared remote control. 9. Support Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 10. Dimensions: 151.21 x 72.42 x8.20-8.36mm 11. Weight: 188-191g Screen Display: 1. Size: 6.32 inch 2. Resolution: 2640 x 1216 pixels, 460 PPI 3. Color: 1070 million colors 4. Brightness: 600 nits, 1800 nits 5. Type: AMOLED, 120Hz refresh rate, 240Hz touch sample rate 6. Screen-to-body Ratio: 93.4% Cameras: 1. Rear: Rear: 200MP wide (f1.8, 24mm, 6P lens, AF, OIS) + 50MP ultra-wide (f2.0, 16mm, 6P lens, AF, 116 degree) + 50MP telephoto (f2.8, 80mm, 4P lens, AF, OIS) 2. Front: 50MP (F2.0, 18mm, 5P lens, AF) Battery: 1. Battery Capacity: 6700mAh 2. Fast Charge: 80W Network Band: 1. 5G: NR N1/3/5/8/18/26/28/34/38/39/40/41/48/66/77/78 2. 4G: FDD-LTE: B1/3/4/5/8/18/19/26/28A/66; TDD-LTE: B34/38/39/40/41/42/43/48 3. 3G: WCDMA B1/4/5/8/19 4. 2G: GSM 850/900/1800MHz 5. Support VoLTE Data Function: 1. WLAN: Support Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n, Wi-Fi 5GHz 160MHz 2. BT: V5.4 3. Data Charge & Headphone Interface: USB Type-C 4. OTG: Support 5. NFC: Support 6. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS, NavIC Package List 1. Phone x 1 2. Data Cable x 1 3. US Plug Charger x 1 4. Eject Pin x 1 5. Protective Case x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs
£648.99
-
HAMTOD HAMTOD H3 Rugged Phone, 2.8 inch T107 ARM CortexTM A7 Quad-core 1.0GHz, Network: 4G, VoLTE, BT, SOS, EU Version
1. CPU: T107, ARM CortexTM A7, quad-core, 1.0GHz2. OS System: RTOS3. Memory: ROM 128MB + RAM 48MB4. Storage Extend: TF card up to 64GB (not included)5. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM6. Charge Port: Type-C 7. Battery: 2000mAh li-ion removable battery8. Features: FM Radio, SOS, torch, VoLTE9. BT: V2.110. Camera: Rear 0.3MP11. Size: 146.2x65.4x17mm12. Weight: 390gDisplay Screen:1. Size: 2.8 inch QVGA TFT screen2. Screen resolution: 320 x 240 pxNetwork Bands:EU Version: 1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz) US Version: 1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz) (Note: Different versions correspond to different frequency bands)Languages:1. EU Version: English, Chinese, Arabic, Portuguese, Russian, Greek, French, Italian, Turkish, Spanish, German, Hebrew, Czech, Dutch, Albanian, Bulgarian, Croatian, Danish, Finnish, Macedonian , Norwegian, Polish, Serbian, Swedish, Hungarian2. US Version: Chinese, English, Portuguese, French, Spanish, Dutch(Note: Different versions have different corresponding languages.)Package List:1. Phone x 12. Power charger x 13. USB cable x 14. Warranty card x 15. Quick user Guide(In 6 languages ??(English, German, Greek, Polish, Russian, Hungarian)) x 16. Lock-pin x 1Specification: General Certificate CE, MSDS, ROHS, FCC, EMC Package Weight One Package Weight 0.39kgs / 0.85lb One Package Size 17cm * 9cm * 6cm / 6.69inch * 3.54inch * 2.36inch Qty per Carton 50 Carton Weight 19.50kgs / 42.99lb Carton Size 36cm * 47cm * 32cm / 14.17inch * 18.5inch * 12.6inch Loading Container 20GP: 492 cartons * 50 pcs = 24600 pcs40HQ: 1143 cartons * 50 pcs = 57150 pcs
£35.99
-
OPPO OPPO K13s 5G, 12GB+512GB, Screen Fingerprint, 6.8 inch ColorOS 15.0 Android 15 Snapdragon 7 Gen 3 Octa Core, NFC, Network: 5G, 12GB+512GB
Specifications: 1. CPU Chip: Snapdragon 7 Gen 3, 8-core, frequency up to 2.63GHz 2. GPU: Adreno GPU 7-series 975MHz 3. RAM + ROM: 12GB + 512GB; RAM: LPDDR4X; ROM: UFS 3.1 4. Extended Storage: Support (not included) 5. SIM Card Type: Nano-SIM card/Nano-USIM card 7. Biometrics Recognition: Fingerprint (Screen), facial recognition 8. Sensor: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, under-screen optical fingerprint sensor 9. Operating System: ColorOS 15.0 / Android 15.0 10. Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 11. Dimensions: 163.13 x 77.58 x 7.70-7.86mm 12. Weight: 195-204g Screen Display: 1. Size: 6.8 inch 2. Resolution: 2800 x 1280 pixels 3. Color: 16.7 million colors 4. Brightness: 600-1600nit 5. Type: AMOLED, 93.5%, 453 PPI, 60/90/120Hz Cameras: 1. Rear: 50MP (f1.8, 5P, AF, IOS) + 2MP (f2.4, 3P) 2. Front: 32MP (f2.4, 5P) Battery: 1. Battery capacity: 7000mAh 2. Fast Charging: 80W Network Band: 1. 5G: NR N1/N3/N5/N8/N28a/N38/N40/N41/N77/N78 2. 4G: FDD-LTE: B1/3/5/8/19/28A; TDD-LTE: B34/38/39/40/41/42/48 3. 3G: WCDMA B1/5/8 4. 2G: GSM 850/900/1800MHz Data Function: 1. WLAN: Support Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n 2. BT: BT 5.2 3. Data & Headphone Interface: USB Type-C 4. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS Packing List: 1. Phone x 1 2. Data cable x 1 3. Charger x 1 4. SIM Eject Pin x 1 5. Protective Case x 1 (Note: subject to actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs
£356.99
-
UNIWA UNIWA P2 Plus UHF Walkie-Talkie Rugged Phone, 3GB+32GB, 4.0 inch Android 9.0 Mediatek MT6762 Octa Core, Network: 4G, NFC, EU Plug, US Plug, UK Plug, AU Plug
1. Model No.: UNIWA P2 Plus2. Operating System: Android 9.03. Processor: MT6762 64 bits octa core, 2.0GHz x 4 + 1.5GHz x 44. RAM+ ROM: 3GB+32GB support Micro SD card up to 256GB (not included)5. Screen: 4.0 inch TFT Corning Gorilla III glove touch IPS capacitive screen, 800 x 480px6. Cameras: Front camera 5MP + Rear camera 13MP with AF & flashlight8. Battery: Removable 7.6V/2800mAh Li-polymer battery, support 2A quick charge9. Sensor: Accelerometer, Geomagnetic, Proximity sensor, Light sensor10. Languages: Multi-language11. Material: Rubber/Plastic12. Dimension: 147 x 70 x 26.5mm (Not including antenna and buttons)13. Weight: 333g (including antenna)Network & Connectivity:1. 2G: GSM 850/900/1800/1900MHz2. 3G: 3G: WCDMA 850/900/1900/2100MHz; TD-SCDMA: B34/B393. 4G: FDD-LTE B1/B3/B5/B7/B8/B20/B28A/B28B; TDD-LTE: B38/B39/B40/B414. Wi-Fi: IEEE 802.11 a/b/g/n/ac, support 2.4G/5GHz dual band WiFi5. BT: V5.06. NFC: Support, 13.56MHz7. GNSS: Support GPS+Galileo or GPS+GLONASS or GPS+BDS I/O Interfaces: 1. Nano SIM card slot x 2: Nano SIM+Nano SIM / Nano SIM + TF Card 2. TF Card slot x 13. Earphone port: M6 standard port x 14. USB Type-C Port x 1Other Functions:1. DMR: Supporting standard-defined voice and data services, as well as various encryption methods2. UHF 400-480MHz (VHF: 350-390MHz or 136-174MHz optional)3. High intercom power: 4W, low Intercom power: 1W4. POC function: SupportStandard Package List:1. Phone x 12. Belt clip x 13. Antenna x 14. Data cable x 15. Charger x 16. User manual x 1Specification: Package Weight One Package Weight 0.65kgs / 1.44lb One Package Size 22cm * 12cm * 8cm / 8.66inch * 4.72inch * 3.15inch Qty per Carton 20 Carton Weight 14.00kgs / 30.86lb Carton Size 42cm * 25cm * 45cm / 16.54inch * 9.84inch * 17.72inch Loading Container 20GP: 564 cartons * 20 pcs = 11280 pcs40HQ: 1310 cartons * 20 pcs = 26200 pcs
£391.99
-
vivo vivo X200s, 12GB+512GB, Face ID / 3D Ultrasonic Fingerprint, 6.67 inch OriginOS 5 / Android 15 Dimensity 9400+ Octa Core, OTG, NFC, Network: 5G, Support Google Play, 12GB+512GB
Specifications: 1. CPU: Dimensity 9400+, 64-bit, octa-core, 3nm, 3.73GHz x 1 + 3.3GHz x 3 + 2.4GHz x 4 2. GPU: Immortalis-G925 3. SIM: Dual SIM (Nano-SIM, dual standby) 4. Memory: 12GB LPDDR5X + 512GB UFS4.1 5. Operating System: Android 15, OriginOS 5 6. Battery: 6200mAh, non-removable 7. Charging Power: 90W wired, 40W wireless 8. Unlock Method: Face Wake ID, 3D Ultrasonic single point fingerprint 9. Sensors: Gravity sensor, light sensor, proximity sensor, physical gyroscope, electronic compass, laser focus sensor; infrared remote control; Flicker sensor; front color temperature sensor; rear color temperature sensor, X-axis linear motor 10. Language: Arabic, Bengali, Burmese, Dutch, English, French, Filipino, German, Hindi, Indonesian, Italian, Japanese, Khmer, Malay, Portuguese, Russian, Romanian, Spanish, Thai, Vietnamese, Nepali, Urdu, Sinhalese, Laotian, Kor., Tibetan, Uyghur 11. Size: 160.01 x 74.29 x 7.99mm 12. Weight: about 203g-205g Screen: 1. Type: AMOLED, 120Hz refresh rate, HDR, 460PPI 2. Size: 6.67 inch (screen-to-body ratio 92.89%) 3. Resolution: 2800 x 1260 pixels, 20:9 ratio 4. Screen Sampling Rate: Normal mode support 130Hz, game mode supports 300Hz Camera: 1. Rear Camera: 50MP main (f1.57) + 50MP wide (f2.0) + 50MP periscope (f2.57) 2. Front camera: 32MP (f2.0) Network: 1. 5G: N1/N2/N3/N5/N7/N8/N18/N25/N26/N28A/N34/N38/N39/N40/N41/N48/N66/N77/N78 2. 4G FDD-LTE: B1/B2/B3/B4/B5/B7/B8/B18/B19/B25/B26/B28A/B66 3. 4G TD-LTE: B34/B38/B39/B40/B41/B42/B43/B48 4. 3G WCDMA: B1/B2/B4/B5/B6/B8/B19 5. 2G GSM: 850/900/1800/1900MHz Connection And Transmission: 1. Wi-Fi: 2.4G&5GHz, support Wi-Fi 6, Wi-Fi 7 2. NFC: Support 3. Navigation: Support, Beidou, GLONASS, Galileo, QZSS, NavIC, GNSS 4. BT: BT 5.4 5. Headphone & USB Interface: Type-C 6. OTG: Support Package List 1. Phone x 1 2. US Plug Charger x 1 3. Type-C Data Cable x 1 4. Protective Case x 1 5. Original Film (pre-attached) x 1 6. SIM Ejector x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.70kgs / 1.55lb One Package Size 21cm * 21cm * 7cm / 8.27inch * 8.27inch * 2.76inch Qty per Carton 20 Carton Weight 15.00kgs / 33.07lb Carton Size 42cm * 45cm * 35cm / 16.54inch * 17.72inch * 13.78inch Loading Container 20GP: 403 cartons * 20 pcs = 8060 pcs40HQ: 935 cartons * 20 pcs = 18700 pcs
£731.99
-
WAVESHARE Waveshare WAVEGO 12-DOF Bionic Dog-Like Robot, Extension Pack, Extension Pack
FeaturesThe WAVEGO is a high-DOF bionic dog-like robot which features 2.3kg.cm large torque servos, reliable structure, and flexible motion, incorporating devices like front camera, 9-axes motion tracker, RGB indicator, etc., together with open source multi-platform Web application. It uses the ESP32 as sub controller for connecting rod inverse solving and gait generation, sharing calculating task for the host controller, an additional Raspberry Pi can be attached as the host controller for high-level decision operating. 1. Overall 12-DOF, multi connecting rods leg design, increasing the servo effective torque 2. A real time operating system is used as sub controller for connecting rod inverse solving and gait generation, sharing calculating task for the host controller and improving the gait solving efficiency 3. Ultra compact structure design, allows using on the table, aluminum alloy + nylon structure materials, ensuring strength while keeping it light weight 4. Additional Raspberry Pi can beattached as the host controller to enable OpenCV high-level functions, demo codes including facial recognition, motion detection, color tracking, and more. Reserved extension interface for secondary development, along with user manual and secondary development documents.SpecificationsGeneral: 1. Product name: WAVEGO high-DOF bionic quadruped robot 2. Stand up: length 218mm, width 116mm, height 152mm 3. Lie down: length 228mm, width 116mm, height 127mm 4. Overall weight: 554g (with batteries) 5. DOF: 12 overall, 3 per single leg Operating system: Demo code: FreeRTOS + Raspberry Pi OS Motion performance: 1. Available gait: Shake hands, stand up, crouch slowly, diagonal gait , jump, self-balancing 2. Motion extension: Providing motion programming example, including flexible Bezier curve speed motion function 3. Load: 200g Servo info.: 1. Dimensions: 23.2 x12.1 x25.25 mm 2. Weight: 13.0 +/- 1g 3. Operating voltage: 6V 4. Idle speed: 0.1sec/60 degree (100RPM) 5. Stalling torque: 2.3kg.cm (31.99oz.in) 6. Rated load: 0.7kg.cm 7. Rated current: 350mA 8. Control method: Pulse width modification 9. Control system type: Digital comparator Visual function: 1. FreeRTOS demo: Web-based real time video streaming 2. Raspberry Pi OS demo: Real time video streaming, facial recognition, color tracking, moving object detection Note: All the demo codes are open sourced, the Raspberry Pi OS demo is based on open source projects flask-streaming and OpenCV Processor and memory: 1. ESP32 sub controller: Processor: Xtensa LX6 dual-core processor 240MHz 2. SRAM: 520KB+8MB 3. Flash: 448KB+4MB Others: 1. WiFi standard: 802.11b/g/n 2. Bluetooth standard: Bluetooth 4.2, including traditional Bluetooth (BR/EDR) and Bluetooth low energy (BLE) 3. External port: 2 x 5P multi-function extension port (host controller communication, power supply selection, assembly mode selection, etc.) 4. DC battery charger jack: Type-C (download, UART communication, peripheral expansion) Power supply: 1. Battery type: 18650 Li-ion batteries (NOT included) 2. Supply voltage: 7-8.4V 3. Recharge voltage: 8.4V 4. Protection: Over charge, discharge protection, over current protection, short circuit protection, reverse proof, equalizing charge, stable and safe operating 5. Output voltage: provides 5V output for other host controllerPackage List1. WAVEGO body case x 1 2. WAVEGO basic parts x 1 3. Semi-transparent acrylic panel x 1 4. Double-sided sticker x 1 5. WAVEGO base board x 1 6. 2MP camera x 1 7. 2.4G antenna x 1 8. 0.91inch OLED display x 1 9. Micro thrust bearing x 14 10. Micro ball flange bearing x 30 11. USB cable (~1m) x 1 12. Plus screwdriver x 1 13. Cross wrench sleeve x 1 14. IPEX 1 to SMA cable (~17cm) x 1 15. Jumper wire (~20cm) x 4 16. 4 PIN PH2.0 cable x 1 17. Servo pack x 1 18. 8.4V 2A battery charger x 1 19. Screws and standoffs x 1Specification: Package Weight One Package Weight 1.08kgs / 2.37lb One Package Size 26cm * 22cm * 10cm / 10.24inch * 8.66inch * 3.94inch Qty per Carton 20 Carton Weight 17.00kgs / 37.48lb Carton Size 52cm * 53cm * 45cm / 20.47inch * 20.87inch * 17.72inch Loading Container 20GP: 215 cartons * 20 pcs = 4300 pcs40HQ: 499 cartons * 20 pcs = 9980 pcs
£194.99
-
OPPO OPPO Reno15c, 12GB+256GB, Screen Fingerprint, 6.59 inch ColorOS 16.0 Qualcomm Snapdragon 7 Gen 4 Octa Core, NFC, OTG, Network: 5G, 12GB+256GB
1. CPU: Qualcomm Snapdragon 7 Gen 4, octa-core, 2.8GHz 2. GPU: Adreno 722 1150MHz 3. RAM + ROM: 12GB LPDDR5X + 256GB UFS 3.1 4. Extended storage: Not support 5. Operating System: ColorOS 16.0 6. SIM card type: Nano-SIM card, Nano-USIM card, support dual SIM cards 7. Biometrics Recognition: Fingerprint (in-screen), facial recognition 8. Sensor: Proximity sensor, ambient light sensor, electronic compass, accelerometer, gyroscope, under-display optical fingerprint sensor, infrared remote control 9. Support Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 10. Dimensions: 158 x 74.83 x 7.77-7.89mm 11. Weight: 197g Screen Display: 1. Size: 6.59 inch 2. Resolution: 2760 x 1256 pixels, 460 PPI 3. Color: 1070 million colors 4. Brightness: 600 nits, 1200 nits 5. Type: 120Hz refresh rate, 240Hz touch sample rate Cameras: 1. Rear: Rear: 50MP wide (f1.8, 26mm, 5P lens, AF, OIS) + 8MP ultra-wide (f2.0, 15mm, 5P lens, AF, 116 degree) + 50MP telephoto (f2.8, 80mm, 4P lens, AF, OIS) 2. Front: 50MP (F2.0, 18mm, 5P lens, AF) Battery: 1. Battery Capacity: 6500mAh 2. Fast Charge: 80W Network Band: 1. 5G: NR N1/3/5/8/18/26/28A/38/40/41/48/77/78 2. 4G: FDD-LTE: B1/3/5/8/18/19/26/28A; TDD-LTE: B34/38/39/40/41/42/43/48 3. 3G: WCDMA B1/5/8/19 4. 2G: GSM 850/900/1800MHz Data Function: 1. WLAN: Support Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n, Wi-Fi 5GHz 160MHz 2. BT: V5.4 3. Data Charge & Headphone Interface: USB Type-C 4. OTG: Support 5. NFC: Support 6. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS Package List 1. Phone x 1 2. Data Cable x 1 3. US Plug Charger x 1 4. Eject Pin x 1 5. Protective Case x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs
£501.99
-
OnePlus OnePlus Ace 5, 12GB+256GB, 6.78 inch ColorOS 15.0 Snapdragon 8 Gen 3 Octa Core, NFC, Network: 5G, 12GB+256GB
Specifications: 1. CPU: Qualcomm Snapdragon 8 Gen 3, octa-core, 4nm, frequency up to 3.3Hz 2. GPU: Adreno 750 903MHz 3. RAM: 12GB LPDDR5X, ROM: 256GB UFS 4.0 4. Operation System: ColorOS 15.0 based on Android 5. Sensors: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, acceleration sensor, gyroscope, under-screen optical fingerprint sensor, Hall sensor, infrared remote control 6. Battery: 6415mAh 7. Fast charging: 80W 8. SIM card: Dual, Nano-SIM card 9. Charging & Headphone Interface: Type-C 10. Language: Arabic, Bengali, Burmese, English, French, Filipino, Hindi, Indonesian, Khmer, Malay, Russian, Thai, Vietnamese, Simple Chinese, Traditional Chinese, Nepali, Laotian, Korean, Tibetan, Uyghur 12. Dimensions: 161.72 x 75.77 x 8.02mm 13. Weight: About 206-223g Display Screen: 1. Type: Flat screen, 450 PPI, 93.9% 2. Size: 6.78 inch 3. Resolution: 2780 x 1264 4. Color: 1.07 billion colors 5. Refresh Rate:1-120Hz Cameras: 1. Rear camera: 50MP main (6P, f1.8, 24mm, OIS, AF) + 8MP wide (5P, f2.2, 16mm, FOV=112 degree) + 2MP macro (3P, f2.4, 22mm) 2. Front Camera: 16MP(IMX480, f2.4) Network Band: 1. 5G NR: N1/N3/N5/N8/N28A/N38/N40/N41/N48/N66/N77/N78 2. 4G: LTE FDD: B1/3/4/5/8/18/19/26/28A/66; LTE TDD: B34/38/39/40/41/42/48 3. WCDMA: B1/4/5/6/8/19 4. GSM: 850/900/1800MHz 5. Support VoLTE 1. WLAN: Support Wi-Fi 7 (802.11be), Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n; WLAN 2.4G/5G/5.8G 3. Bluetooth: V5.4 4. NFC: Yes 5. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS, A-GNSS assisted positioning, wireless LAN positioning, cellular network positioning Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Charger x 1 6. Pre-applied protective film x 1 (The actual object shall prevail)Specification: Package Weight One Package Weight 0.65kgs / 1.43lb One Package Size 20cm * 12cm * 8cm / 7.87inch * 4.72inch * 3.15inch Qty per Carton 20 Carton Weight 14.00kgs / 30.86lb Carton Size 42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch Loading Container 20GP: 604 cartons * 20 pcs = 12080 pcs40HQ: 1403 cartons * 20 pcs = 28060 pcs
£372.99