Resultados de la búsqueda de "camera case"

Specifications: 1. CPU: MediaTek Dimensity 9500, octa-core, 4.21GHz 2. GPU: ARM Mali Drage MC12 3. RAM+ROM: 12GB+512GB LPDDR5X + UFS 4.1 4. Operation System: ColorOS 16.0 based on Android 16 5. Sensors: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, infrared remote control 6. Battery: 8600mAh 7. Fast charging: 120W 8. SIM card: Dual, Nano-SIM card 9. Charging & Headphone Interface: Type-C 10. Language: Arabic, Bengali, Burmese, English, French, Filipino, Hindi, Indonesian, Khmer, Malay, Russian, Thai, Vietnamese, Simple Chinese, Traditional Chinese, Nepali, Laotian, Korean, Tibetan, Uyghur 12. Dimensions: 162.5 x 77.5 x 8.5 mm 13. Weight: About 217g-219g Display Screen: 1. Type: AMOLED, 450 PPI, 93.6% 2. Size: 6.78 inch 3. Resolution: 2772x1272 4. Color: 1.07 billion colors 5. Refresh Rate: 60/90/120/144/165Hz Cameras: 1. Rear: 50MP main wide (f1.8) + 8MP ultra wide (f2.2) 2. Front: 16MP( f2.4) Network & Connect: 1. 5G NR: N1/3/5/8/18/26/28A/34/38/39/40/41/48/66/77/78 2. 4G: 4G LTE FDD: B1/3/4/5/8/18/19/26/28A/66; 4G LTE TDD: B34/38/39/40/41/42/43/48, Support VoLTE 3. WCDMA: B1/5/6/8/19 4. GSM: 850/900/1800MHz 5. WLAN: Support Wi-Fi 7 (802.11be), Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n; WLAN 2.4G/5GHz 6. BT: V6.0 7. NFC: Yes 6. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS, NavIC Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Charger x 1 6. Pre-applied protective film x 1 (The actual object shall prevail)Specification: Package Weight One Package Weight 0.65kgs / 1.43lb One Package Size 20cm * 12cm * 8cm / 7.87inch * 4.72inch * 3.15inch Qty per Carton 20 Carton Weight 14.00kgs / 30.86lb Carton Size 42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch Loading Container 20GP: 604 cartons * 20 pcs = 12080 pcs40HQ: 1403 cartons * 20 pcs = 28060 pcs

Leer Más Menos

Specifications: 1. CPU Chip: MediaTek Dimensity 6300, 8-core, frequency up to 2.4GHz 2. GPU: ARM Mali-G57 MC2 1072MHz 3. RAM + ROM: 8GB LPDDR4X + 512GB UFS 2.2 4. Extended Storage: Support (not included) 5. SIM Card Type: Nano-SIM card/Nano-USIM card 7. Biometrics Recognition: Fingerprint (Side), facial recognition 8. Sensor: Proximity sensor, ambient light sensor, electronic compass, accelerometer, side fingerprint sensor 9. Operating System: ColorOS 15.0 10. Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 11. Dimensions: 166.61 x 78.51 x 8.61mm 12. Weight: 216g Screen Display: 1. Size: 6.75 inch 2. Resolution: 1570 x 720 pixels 3. Type: LCD, 89.9%, 264 PPI, 120Hz 4. Touch sampling rate: Up to 240Hz 5. Color: 16.7 million colors Cameras: 1. Rear: 50MP (f1.8, 27mm, 5P, AF) + 2MP (f2.4, 22mm, 3P) 2. Front: 8MP (f2.0, 25mm, 4P) Battery: 1. Battery capacity: 7000mAh 2. Fast Charging: 45W Network Band: 1. 5G: NR N1/3/5/8/28a/41/48/77/78 2. 4G: FDD-LTE: B1/3/5/8/28A; TDD-LTE: B34/38/39/40/41 3. 3G: WCDMA B1/5/8 4. 2G: GSM 900/1800MHz Data Function: 1. WLAN: Support Wi-Fi 5 (802.11ac), 802.11a/b/g/n, Wi-Fi Display 2. BT: V5.4 3. Data Interface: USB Type-C 4. Headphone Jack: Type-C 5. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS Packing List: 1. Phone x 1 2. Data cable x 1 3. Charger x 1 4. SIM Eject Pin x 1 5. Protective Case x 1 (Note: subject to actual product)Specification: Package Weight One Package Weight 0.52kgs / 1.15lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs

Leer Más Menos

Specifications: 1. CPU Chip: MediaTek Dimensity 6300, 8-core, frequency up to 2.4GHz 2. GPU: ARM Mali-G57 MC2 1072MHz 3. RAM + ROM: 12GB LPDDR4X + 512GB UFS 2.2 4. Extended Storage: Support 5. SIM Card Type: Nano-SIM card/Nano-USIM card 7. Biometrics Recognition: Support side fingerprint recognition 8. Sensor: Proximity sensor, ambient light sensor, electronic compass, accelerometer, side fingerprint sensor 9. Operating System: ColorOS 15.0 based on Android 15 10. Languages: Arabic, Bengali, Burmese, Czech, French, English, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 11. Dimensions: 166.60 x 78.5 x 8.61mm 12. Weight: 216g Screen Display: 1. Size: 6.75 inch 2. Resolution: 1570 x 720 pixels 3. Type: LCD, 90.6%, 256 PPI, 60/90/120Hz refresh rate, 240Hz touch sampling rate 4. Color: 16.7 million colors Cameras: 1. Rear: 50MP (f1.8, 27mm, 5P, AF) + 2MP (f2.4, 22mm, 3P) 2. Front: 8MP (f2.0, 22mm, 4P) Battery: 1. Battery capacity: 7000mAh 2. Fast Charging: 45W Network Band: 1. 5G: NR N1/3/5/8/28A/41/48/77/78 2. 4G: FDD-LTE B1/3/5/8/28A; TDD-LTE B34/38/39/40/41 3. 3G: WCDMA B1/5/8 4. 2G: GSM 900/1800MHz 5. Support VoLTE Data Function: 1. WLAN: Support Wi-Fi 5 (802.11ac), 802.11 a/b/g/n, Wi-Fi Display 2. BT: V5.4 3. Data Interface: Type-C 4. Headphone Jack: Type-C 5. Positioning: BeiDou, GPS, GLONASS, Galileo, QZSS, A-GPS Packing List: 1. Phone x 1 2. Data cable x 1 3. Charger x 1 4. SIM Eject Pin x 1 5. Protective Case x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.52kgs / 1.15lb One Package Size 21cm * 16cm * 6cm / 8.27inch * 6.3inch * 2.36inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 42cm * 33cm * 32cm / 16.54inch * 12.99inch * 12.6inch Loading Container 20GP: 601 cartons * 20 pcs = 12020 pcs40HQ: 1395 cartons * 20 pcs = 27900 pcs

Leer Más Menos

Specifications: 1. CPU: Qualcomm Snapdragon 8s Gen 4, octa-core, 4nm, 3.2GHz 2. GPU: Adreno 825 1.15GHz 3. RAM+ROM: 16GB+256GB LPDDR5X + UFS 4.1 4. Operation System: ColorOS 16.0 based on Android 5. Sensors:Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, under-display optical fingerprint sensor, infrared remote control 6. Battery: 9000mAh 7. Fast charging: 80W 8. SIM card: Dual, Nano-SIM card 9. Charging & Headphone Interface: Type-C 10. Language: Arabic, Bengali, Burmese, English, French, Filipino, Hindi, Indonesian, Khmer, Malay, Russian, Thai, Vietnamese, Simple Chinese, Traditional Chinese, Nepali, Laotian, Korean, Tibetan, Uyghur 12. Dimensions: 162.46 x 77.45 x 8.50mm 13. Weight: About 217g Display Screen: 1. Type: Flat screen, 450 PPI, 93.5% 2. Size: 6.78 inch 3. Resolution: 2772 x 1272 4. Color: 1.07 billion colors 5. Refresh Rate: 60/90/120/144/165Hz 6. Glass: Crystal Shield Glass Cameras: 1. Rear: 50MP main (f1.88) + 2MP wide (f2.4) 2. Front: 16MP( f2.4) Network & Connect: 1. 5G NR: N1/3/5/8/28A/38/40/41/48/77/78 2. 4G: LTE FDD: B1/3/5/8/19/28A; LTE TDD: B34/38/39/40/41/42/48; Support VoLTE 3. WCDMA: B1/5/8 4. GSM: 850/900/1800MHz 5. WLAN: Support Wi-Fi 7 (802.11be), Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n 6. BT: V6.0 7. NFC: Yes 6. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Charger x 1 (The actual object shall prevail)Specification: Package Weight One Package Weight 0.65kgs / 1.43lb One Package Size 20cm * 12cm * 8cm / 7.87inch * 4.72inch * 3.15inch Qty per Carton 20 Carton Weight 14.00kgs / 30.86lb Carton Size 42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch Loading Container 20GP: 604 cartons * 20 pcs = 12080 pcs40HQ: 1403 cartons * 20 pcs = 28060 pcs

Leer Más Menos

1. CPU: MediaTek Dimensity 8400-MAX, octa core, 4nm, 64 bit, 3.25GHz 2. GPU: Mali-G720 1.3GHZ 3. RAM + ROM: 16GB LPDDR5X + 512GB UFS4.0 4. Extended Storage: Not support 5. System: Realme UI 6.0 is based on Android 15 6. NFC: Yes 7. SIM card Type: Nano-SIM card, dual SIM cards 8. Sensor: Light & color temperature sensor, distance sensor, geomagnetic sensor, acceleration sensor, gyroscope sensor, infrared remote control, under-screen optical fingerprint 9. Supported languages: Arabic, Bengali, Burmese, Czech, French, English, Portuguese, Spanish, Filipino, Hindi, Indonesian, Japanese, Khmer, Malay, Turkish, Thai, Vietnamese, Traditional Chinese, Nepali, Lao, Kor., Tibetan, Uyghur 10. Dimensions: 162.53 x 76.27 x 212g 11. Weight: About 213g Screen Display: 1. Size: 6.78 inch Eye protection gaming flat screen 2. Resolution: 1264 x 2780 pixel, 450PPI 3. Color: 1.07 billion colors 4. Touch sampling rate: 360Hz, 2600Hz instantaneous 5. Screen-to-body Ratio: 93.9% Camera: 1. Rear: 50MP main (IMX882, 26mm, f1.8, OIS) 8MP wide (16mm, f2.2) 2. Front: 16MP (23mm, F2.4) Battery: 1. Battery Capacity: 7000mAh 2. Fast Charging: 80W smart flash charge Network Band: 1. 5G NR: N1/N3/N5/N8/N20/N28a/N38/N40/N41/N66/N77/N78 2. 4G FDD-LTE: B1/3/4/5/8/19/20/28A/66; TDD-LTE: B34/38/39/40/41 3. 3G WCDMA: B1/4/5/6/8/19 4. 2G GSM: 850/900/1800MHz Data Function: 1. Wi-Fi: 802.11 a/b/g/n/ac/ax/be, 2.4/5GHz 2. Bluetooth-compatible: BT 5.4 3. Headphone & Charging Data Interface: Type-C 4. Positioning Function: Beidou, GPS, GLONASS, Galileo, QZSS Packing List: 1. Phone x 1 2. Data cable x 1 3. US Plug Charger x 1 4. SIM Eject Pin x 1 5. Protective Case x 1 (Note: Subject to actual product)Specification: Package Weight One Package Weight 0.53kgs / 1.17lb One Package Size 20cm * 20cm * 5cm / 7.87inch * 7.87inch * 1.97inch Qty per Carton 20 Carton Weight 11.00kgs / 24.25lb Carton Size 42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch Loading Container 20GP: 604 cartons * 20 pcs = 12080 pcs40HQ: 1403 cartons * 20 pcs = 28060 pcs

Leer Más Menos

1. 3 carrying methods, switch freely to control the rhythm of life, and always show confidence and calmness2. Lightweight fabric, impermeable to rainwater, dry with one wipe. Flexible and wear-resistant, the skin touch is made of micro-elastic high-density release paper composite fabric, leaving no creases, light and environmentally friendly3. Internal large-capacity storage space, built-in laptop interlayer, books, certificates, digital equipment, reasonable storage4. Fine compartments, considerate loading, multi-format storage design in the main compartment, neat and not messy, computer compartment with protective function, so that the world can work smoothly5. The hook and loop fastener is fixed, the computer does not directly touch the bottom of the backpack, the buffer collision better protects the computer, and can hold a 15.6-inch computer6. Convenient front pocket, anti-theft pocket on the back7. The back pad adopts a 3D air-guiding back panel design to promote the free circulation of air, keep the back dry and reduce the pressure on the back, and travel worry-free in summer8. The back pad is made of three different materials: soft and comfortable sandwich mesh + elastic sponge for relieving heavy load + decompression and shock-resistant high-elastic EVA cotton9. The bottom fixing buckle fixes the camera frame10. The front fixing buckle can hang skateboards, helmets, etc.11. No matter at the airport or at the station, you can hang the backpack on the trolley case while waiting to reduce the burden on your travel and transfer the weight of the backpack to the wheels12. Smooth and durable zipper bite tightly, smooth experience without stuttering13. Reinforced portable, comfortable and not tight, can bear heavy weight14. The triangle reinforcement interface at the junction adopts multiple reinforcements of inverted triangles15. Shoulder strap card slot Convenient shoulder strap card slot design, convenient and practical16. The fixed buckle has a high-quality rubber lock, which is strong and durable17. The adjustable chest buckle can be used to fix the bag when carrying it, so that the center of gravity of the bag does not shift18. Fabric: leather film + oxford cloth19. Structure: functional bag/zipper bag, compartment bag/computer bag, etc.20. Capacity: can be loaded into ipad, mobile phone, 15.6-inch computer, etc.21. Size: 29x13x49cm22. Weight: 1.2 kgSpecification: Package Weight One Package Weight 1.30kgs / 2.87lb One Package Size 50cm * 6cm * 32cm / 19.69inch * 2.36inch * 12.6inch Qty per Carton 1 Carton Weight 1.30kgs / 2.87lb Carton Size 50cm * 6cm * 32cm / 19.69inch * 2.36inch * 12.6inch Loading Container 20GP: 2777 cartons * 1 pcs = 2777 pcs40HQ: 6448 cartons * 1 pcs = 6448 pcs

Leer Más Menos

Specifications: 1. CPU: MediaTek Dimensity 7360 SUPER,octa-core, 4nm, 2.5GHz 2. GPU: Arm Mali-G615 1047MHz 3. RAM+ROM: 12GB+256GB, supports expansion card (not included) 4. Operation System: ColorOS 16.0 based on Android 5. Sensors: Proximity sensor, ambient light sensor, electronic compass, accelerometer, gyroscope 6. Battery: 7000mAh 7. Fast charging: 45W 8. SIM card: Dual, Nano-SIM card 9. Charging & Headphone Interface: Type-C 10. Language: Arabic, Bengali, Burmese, English, French, Filipino, Hindi, Indonesian, Khmer, Malay, Russian, Thai, Vietnamese, Simple Chinese, Traditional Chinese, Nepali, Laotian, Korean, Tibetan, Uyghur 12. Dimensions: 165.85 x 76 x 8.55mm 13. Weight: About 208g Display Screen: 1. Type: Flat screen, 391 PPI, 91.4% 2. Size: 6.72 inch 3. Resolution: 2400 x 1080 4. Color: 16.7 million colors 5. Refresh Rate: 60/90/120Hz Cameras: 1. Rear: 50MP wide (f1.8) + 2MP white and black (f2.4) 2. Front: 8MP( f2.0) Network & Connect: 1. 5G NR: N1/5/8/28A/41/77/78 2. 4G: LTE FDD: B1/3/5/8/19/28A; LTE TDD: B34/38/39/40/41; Support VoLTE 3. WCDMA: B1/5/8 4. GSM: 850/900/1800MHz 5. WLAN: Support Wi-Fi 5 (802.11ac), 802.11a/b/g/n 6. BT: V5.4 7. NFC: Yes 6. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Charger x 1 (The actual object shall prevail)Specification: Package Weight One Package Weight 0.65kgs / 1.43lb One Package Size 20cm * 12cm * 8cm / 7.87inch * 4.72inch * 3.15inch Qty per Carton 20 Carton Weight 14.00kgs / 30.86lb Carton Size 42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch Loading Container 20GP: 604 cartons * 20 pcs = 12080 pcs40HQ: 1403 cartons * 20 pcs = 28060 pcs

Leer Más Menos

Specifications: 1. CPU: MediaTek Dimensity 7400 SUPER,octa-core, 4nm, 2.6GHz 2. GPU: ARM Mali-G615 1300MHz 3. RAM+ROM: 8GB+128GB 4. Operation System: ColorOS 16.0 based on Android 5. Sensors: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, under-display optical fingerprint sensor, infrared remote control. 6. Battery: 8000 mAh 7. Fast charging: 80W 8. SIM card: Dual, Nano-SIM card 9. Charging & Headphone Interface: Type-C 10. Language: Arabic, Bengali, Burmese, English, French, Filipino, Hindi, Indonesian, Khmer, Malay, Russian, Thai, Vietnamese, Simple Chinese, Traditional Chinese, Nepali, Laotian, Korean, Tibetan, Uyghur 12. Dimensions: 162.60 x 77.6 x 8.80mm 13. Weight: About 213g Display Screen: 1. Type: Flat screen, 450 PPI, 93.6% 2. Size: 6.78 inch 3. Resolution: 2772 x 1272 4. Color: 1.07 billion colors 5. Refresh Rate: 60/90/120Hz, Max 144Hz Cameras: 1. Rear: 50MP wide (f1.8) + 8MP ultra wide (f2.2) 2. Front: 16MP( f2.4) Network & Connect: 1. 5G NR: N1/3/5/8/28A/38/40/41/77/78 2. 4G: LTE FDD: B1/3/5/8/19/28A; LTE TDD: B34/38/39/40/41; Support VoLTE 3. WCDMA: B1/5/6/8/19 4. GSM: 850/900/1800MHz 5. WLAN: Support Wi-Fi 5 (802.11ac), 802.11a/b/g/n 6. BT: V5.4 7. NFC: Yes 6. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Charger x 1 (The actual object shall prevail)Specification: Package Weight One Package Weight 0.65kgs / 1.43lb One Package Size 20cm * 12cm * 8cm / 7.87inch * 4.72inch * 3.15inch Qty per Carton 20 Carton Weight 14.00kgs / 30.86lb Carton Size 42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch Loading Container 20GP: 604 cartons * 20 pcs = 12080 pcs40HQ: 1403 cartons * 20 pcs = 28060 pcs

Leer Más Menos

1. CPU: SC9832+NRF28222. RAM: 2GB/4GB3. ROM: 16GB/128G4. Camera (front/side): 5MP / 8MP5. Battery: 850mAh6. Network: 4G-LTE TDDLTE+FDDLTE7. System: Android 9.18. Positioning: GPS+GLONASS9. Sensor: blood oxygen sensor10. Bluetooth: V5.011. Case material: ceramic12. Dial material: glass13. Strap Material: Silicone14. Screen: 1.75 inches 320x385 resolution15. Charging time: 1.5 hours16. Use time: 24 hours17. Standby time: 7-10 days18. Waterproof: IP67 life waterproof19. SIM card: Nano SIM card20. Network band:- FDD LTE: B1(2100)B2(1900)B3(1800)B5(850)B7(2600)B8(900)B12(700)B17(700)B20(800)- WCDMA: B1(2100)B5(850)B2(1900)- GSM: B2(1900)B3(1800) B5(850) B8(900)21. Audio format: MP3, WMA, Flac22. Video format: MP4 RMVB, RM23. Image format: JPG, PNG, Gif24. Data transmission method: Pogo pin25. Languages: Simplified Chinese, English, Italian, French, German, Spanish, Portuguese, Russian, Japanese, Thai, Arabic, Korean, Greek, Korean, Dutch, Tagalog, Danish26. Other functions: voice recorder, calendar, voice search, face recognition, video chat, pedometer, heart rate, information, map, music sync function, weather, alarm, Google APP27. Dimensions: 50.4x41mm28. Thickness: 16.1mm29. Strap width: 22mm30. Watch net weight: 90g31. Packing List- Watch x 1- User Manual x 1- 5 Pin Magnetic Data Cable x 1- Screwdriver x 1Specification: Package Weight One Package Weight 0.32kgs / 0.69lb One Package Size 12cm * 11cm * 7.5cm / 4.72inch * 4.33inch * 2.95inch Qty per Carton 30 Carton Weight 9.00kgs / 19.84lb Carton Size 53cm * 24cm * 25cm / 20.87inch * 9.45inch * 9.84inch Loading Container 20GP: 838 cartons * 30 pcs = 25140 pcs40HQ: 1946 cartons * 30 pcs = 58380 pcs

Leer Más Menos

Specifications: 1. CPU: Qualcomm Snapdragon 4 Gen 2, octa-core, 4nm, 2.2GHz x 2+1.95GHz x 6 2. GPU: Adreno 613 3. SIM: Dual SIM, Nano-SIM, dual standby 4. Memory: 8GB LPDDR4X + 256GB UFS 3.1 5. Operating System: Android 16, OriginOS 6 6. Battery: 6500mAh, non-removable 7. Charging: 15W 8. Unlock Method: Facial recognition, side fingerprint 9. Sensors: Gravity sensor, light sensor, proximity sensor, electronic compass, fingerprint sensor, infrared remote control, motor 10. Language: Arabic, Bengali, Burmese, Dutch, English, French, Filipino, German, Hindi, Indonesian, Italian, Japanese, Khmer, Malay, Portuguese, Russian, Romanian, Spanish, Thai, Vietnamese, Nepali, Urdu, Sinhalese, Laotian, Kor., Tibetan, Uyghur 11. Size: 167.40 x 77.10 x 8.39mm 12. Weight: 209g Screen: 1. Type: LCD, 120Hz refresh rate, 90.40%, 20:9, 260PPI 2. Size: 6.74 inch 3. Resolution: 1600 x 720 pixels Camera: 1. Rear: 13MP f1.2.2 2. Front: 5MP f2.2 Network: 1. 5G: N1/3/5/8/28A/38/40/41/77/78 2. 4G FDD-LTE: B1/B3/B4/B5/B8/B28A/B66 3. 4G TD-LTE: B34/B38/B39/B40/B41 4. 3G WCDMA: B1/B5/B8 5. 2G GSM: 850/900/1800MHz Connection And Transmission: 1. Wi-Fi: WLAN 2.4G, WLAN 5.0 2. OTG: Support 3. Navigation: GPS, BeiDou, GLONASS, Galileo, QZSS, AGPS 4. BT: V5.1 5. USB Interface: Type-C 6. Earphone Interface: 3.5mm Package List 1. Phone x 1 2. US Plug Charger x 1 3. Type-C Data Cable x 1 4. Protective Case x 1 5. Original Film(pre-applied) x 1 6. Card Ejector x 1 7. Packing Box x 1 (Note: Subject to the actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 21cm * 7cm / 8.27inch * 8.27inch * 2.76inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 45cm * 35cm / 16.54inch * 17.72inch * 13.78inch Loading Container 20GP: 403 cartons * 20 pcs = 8060 pcs40HQ: 935 cartons * 20 pcs = 18700 pcs

Leer Más Menos

Specifications: 1. CPU: Qualcomm Snapdragon 4 Gen 2, octa-core, 4nm, 2.2GHz x 2+1.95GHz x 6 2. GPU: Adreno 613 3. SIM: Dual SIM, Nano-SIM, dual standby 4. Memory: 6GB LPDDR4X + 128GB UFS 3.1 5. Operating System: Android 16, OriginOS 6 6. Battery: 6500mAh, non-removable 7. Charging: 15W 8. Unlock Method: Facial recognition, side fingerprint 9. Sensors: Gravity sensor, light sensor, proximity sensor, electronic compass, fingerprint sensor, infrared remote control, motor 10. Language: Arabic, Bengali, Burmese, Dutch, English, French, Filipino, German, Hindi, Indonesian, Italian, Japanese, Khmer, Malay, Portuguese, Russian, Romanian, Spanish, Thai, Vietnamese, Nepali, Urdu, Sinhalese, Laotian, Kor., Tibetan, Uyghur 11. Size: 167.40 x 77.10 x 8.39mm 12. Weight: 209g Screen: 1. Type: LCD, 120Hz refresh rate, 90.40%, 20:9, 260PPI 2. Size: 6.74 inch 3. Resolution: 1600 x 720 pixels Camera: 1. Rear: 13MP f1.2.2 2. Front: 5MP f2.2 Network: 1. 5G: N1/3/5/8/28A/38/40/41/77/78 2. 4G FDD-LTE: B1/B3/B4/B5/B8/B28A/B66 3. 4G TD-LTE: B34/B38/B39/B40/B41 4. 3G WCDMA: B1/B5/B8 5. 2G GSM: 850/900/1800MHz Connection And Transmission: 1. Wi-Fi: WLAN 2.4G, WLAN 5.0 2. OTG: Support 3. Navigation: GPS, BeiDou, GLONASS, Galileo, QZSS, AGPS 4. BT: V5.1 5. USB Interface: Type-C 6. Earphone Interface: 3.5mm Package List 1. Phone x 1 2. US Plug Charger x 1 3. Type-C Data Cable x 1 4. Protective Case x 1 5. Original Film(pre-applied) x 1 6. Card Ejector x 1 7. Packing Box x 1 (Note: Subject to the actual product)Specification: Package Weight One Package Weight 0.62kgs / 1.37lb One Package Size 21cm * 21cm * 7cm / 8.27inch * 8.27inch * 2.76inch Qty per Carton 20 Carton Weight 13.00kgs / 28.66lb Carton Size 42cm * 45cm * 35cm / 16.54inch * 17.72inch * 13.78inch Loading Container 20GP: 403 cartons * 20 pcs = 8060 pcs40HQ: 935 cartons * 20 pcs = 18700 pcs

Leer Más Menos

Specifications: 1. CPU: MediaTek Dimensity 9500, octa-core, 4.21GHz 2. GPU: ARM Mali Drage MC12 3. RAM+ROM: 16GB+512GB LPDDR5X + UFS 4.1 4. Operation System: ColorOS 16.0 based on Android 16 5. Sensors: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, accelerometer, gyroscope, infrared remote control 6. Battery: 8600mAh 7. Fast charging: 120W 8. SIM card: Dual, Nano-SIM card 9. Charging & Headphone Interface: Type-C 10. Language: Arabic, Bengali, Burmese, English, French, Filipino, Hindi, Indonesian, Khmer, Malay, Russian, Thai, Vietnamese, Simple Chinese, Traditional Chinese, Nepali, Laotian, Korean, Tibetan, Uyghur 12. Dimensions: 162.5 x 77.5 x 8.5 mm 13. Weight: About 217g-219g Display Screen: 1. Type: AMOLED, 450 PPI, 93.6% 2. Size: 6.78 inch 3. Resolution: 2772x1272 4. Color: 1.07 billion colors 5. Refresh Rate: 60/90/120/144/165Hz Cameras: 1. Rear: 50MP main wide (f1.8) + 8MP ultra wide (f2.2) 2. Front: 16MP( f2.4) Network & Connect: 1. 5G NR: N1/3/5/8/18/26/28A/34/38/39/40/41/48/66/77/78 2. 4G: 4G LTE FDD: B1/3/4/5/8/18/19/26/28A/66; 4G LTE TDD: B34/38/39/40/41/42/43/48, Support VoLTE 3. WCDMA: B1/5/6/8/19 4. GSM: 850/900/1800MHz 5. WLAN: Support Wi-Fi 7 (802.11be), Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n; WLAN 2.4G/5GHz 6. BT: V6.0 7. NFC: Yes 6. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS, NavIC Package List 1. Phone x 1 2. Eject Pin x 1 3. Protective Case x 1 4. USB Cable x 1 5. US Plug Charger x 1 6. Pre-applied protective film x 1 (The actual object shall prevail)Specification: Package Weight One Package Weight 0.65kgs / 1.43lb One Package Size 20cm * 12cm * 8cm / 7.87inch * 4.72inch * 3.15inch Qty per Carton 20 Carton Weight 14.00kgs / 30.86lb Carton Size 42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch Loading Container 20GP: 604 cartons * 20 pcs = 12080 pcs40HQ: 1403 cartons * 20 pcs = 28060 pcs

Leer Más Menos